|
|
| | Cyclopentanol,1-(1-methylethyl)- Basic information |
| Product Name: | Cyclopentanol,1-(1-methylethyl)- | | Synonyms: | 1-Isopropylcyclopentanol;Cyclopentanol,1-(1-methylethyl)-;1-propan-2-ylcyclopentan-1-ol;1-Isopropylcyclopentanol 1462-05-1;Cyclopentanol,1-(1-methylethyl)- ISO 9001:2015 REACH;1462-05-1----Cyclopentanol,1-(1-methylethyl)-;1-Isopropylcyclopentan-1-ol;1-isopropylcyclopentylol | | CAS: | 1462-05-1 | | MF: | C8H16O | | MW: | 128.21 | | EINECS: | | | Product Categories: | | | Mol File: | 1462-05-1.mol |  |
| | Cyclopentanol,1-(1-methylethyl)- Chemical Properties |
| Melting point | 21-22 °C | | Boiling point | 73 °C(Press: 16 Torr) | | density | 0.9085 g/cm3(Temp: 25 °C) | | pka | 15.24±0.20(Predicted) | | InChI | InChI=1S/C8H16O/c1-7(2)8(9)5-3-4-6-8/h7,9H,3-6H2,1-2H3 | | InChIKey | PVHCTQIRJHNLMY-UHFFFAOYSA-N | | SMILES | C1(C(C)C)(O)CCCC1 |
| | Cyclopentanol,1-(1-methylethyl)- Usage And Synthesis |
| | Cyclopentanol,1-(1-methylethyl)- Preparation Products And Raw materials |
|