- Boc-L-Ala-Ome
-
- $0.00/ kg
-
2026-04-03
- CAS:28875-17-4
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T+
|
| | BOC-L-ALANINE METHYL ESTER Basic information |
| Product Name: | BOC-L-ALANINE METHYL ESTER | | Synonyms: | L-Alanine methyl ester, N-BOC protected;Methyl (2S)-2-[(tert-butoxycarbonyl)amino]propanoate;Methyl (S)-2-(tert-butoxycarbonylamino)propanoate;(S)-Methyl 2-(tert-butoxycarbonylaMino)propanoate;N-Boc-L-alanine Methyl ester, 95%;Methyl N-(tert-butoxycarbonyl)-L-alaninate;BOC-L-Ala-Methyl ester;BOC-ALA-OME | | CAS: | 28875-17-4 | | MF: | C9H17NO4 | | MW: | 203.24 | | EINECS: | 1533716-785-6 | | Product Categories: | | | Mol File: | 28875-17-4.mol |  |
| | BOC-L-ALANINE METHYL ESTER Chemical Properties |
| Melting point | 32-35 °C(lit.) | | Boiling point | 278℃ | | density | 1.03 g/mL at 25 °C(lit.) | | refractive index | 1.4315 (estimate) | | Fp | >230 °F | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | pka | 11.21±0.46(Predicted) | | form | Powder | | color | White | | Optical Rotation | [α]21/D 45°, c = 1 in methanol | | BRN | 1872545 | | Major Application | peptide synthesis | | InChI | 1S/C9H17NO4/c1-6(7(11)13-5)10-8(12)14-9(2,3)4/h6H,1-5H3,(H,10,12)/t6-/m0/s1 | | InChIKey | GJDICGOCZGRDFM-LURJTMIESA-N | | SMILES | COC(=O)[C@H](C)NC(=O)OC(C)(C)C |
| WGK Germany | 3 | | HS Code | 2922498590 | | Storage Class | 11 - Combustible Solids |
| | BOC-L-ALANINE METHYL ESTER Usage And Synthesis |
| Uses | N-tert-Butoxycarbonylalanine Methyl Ester is a useful synthetic intermediate. It was used in the synthesis of peptidomimetic inhibitors of the human cytomegalovirus protease. It was also used in the preparation of 6-hydrazinopurine 2'-Me ribonucleosides and their 5'-monophosphate analogs as hepatitis C virus inhibitor prodrugs. | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | BOC-L-ALANINE METHYL ESTER Preparation Products And Raw materials |
|