|
|
| | 2-AMINO-6-CHLORO-9H-PURINE-9-ACETIC ACID Basic information |
| | 2-AMINO-6-CHLORO-9H-PURINE-9-ACETIC ACID Chemical Properties |
| Melting point | >300 °C (lit.) | | Boiling point | 609.4±65.0 °C(Predicted) | | density | 1.99±0.1 g/cm3(Predicted) | | storage temp. | -20°C, protect from light | | pka | 3.39±0.10(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C7H6ClN5O2/c8-5-4-6(12-7(9)11-5)13(2-10-4)1-3(14)15/h2H,1H2,(H,14,15)(H2,9,11,12) | | InChIKey | LRZBBTTUKFVUMZ-UHFFFAOYSA-N | | SMILES | N1C2C(=NC(N)=NC=2Cl)N(CC(O)=O)C=1 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2-AMINO-6-CHLORO-9H-PURINE-9-ACETIC ACID Usage And Synthesis |
| Uses | 2-Amino-6-chloro-9H-purine-9-acetic acid may be used as starting material in the synthesis of:
- 6-decyloxy substituted purine intermediates
- 6-decylthio substituted purine intermediates
- 6-decyloxy or 6-decylthio-9-phenylalanine/serine or alanine-substituted purine derivatives
- 2,6-diaminopurine monomer
| | General Description | 2-Amino-6-chloro-9H-purine-9-acetic acid is a purine derivative. |
| | 2-AMINO-6-CHLORO-9H-PURINE-9-ACETIC ACID Preparation Products And Raw materials |
|