| Company Name: |
Shanghai Ruipu Medical Technology Co., Ltd Gold
|
| Tel: |
15895968936 |
| Email: |
1018762393@qq.com |
| Products Intro: |
Product Name:3-Fluoropyridine-2-carboxylic acid tert-butyl ester
CAS:1934827-83-4
Purity:98% Package:1G,10g，100g
|
| Company Name: |
Bide Pharmatech Ltd.
|
| Tel: |
400-164-7117 18317119277 |
| Email: |
product02@bidepharm.com |
| Products Intro: |
Product Name:tert-Butyl 3-fluoropicolinate
CAS:1934827-83-4
Purity:95% Package:250mg;1g;5g;25g Remarks:BD754221
|
| Company Name: |
Shanghai YuanYe Biotechnology Co., Ltd.
|
| Tel: |
13636370518 |
| Email: |
shyysw007@163.com |
| Products Intro: |
Product Name:3-Fluoropyridine-2-carboxylic acid tert-butyl ester
CAS:1934827-83-4
Purity:98% Package:5g Remarks:S37917
|
|
| | 3-Fluoropyridine-2-carboxylic acid tert-butyl ester Basic information |
| | 3-Fluoropyridine-2-carboxylic acid tert-butyl ester Chemical Properties |
| storage temp. | Inert atmosphere,Room Temperature | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C10H12FNO2/c1-10(2,3)14-9(13)8-7(11)5-4-6-12-8/h4-6H,1-3H3 | | InChIKey | XOLAQCBNGMBLPQ-UHFFFAOYSA-N | | SMILES | C1(C(OC(C)(C)C)=O)=NC=CC=C1F |
| | 3-Fluoropyridine-2-carboxylic acid tert-butyl ester Usage And Synthesis |
| | 3-Fluoropyridine-2-carboxylic acid tert-butyl ester Preparation Products And Raw materials |
|