|
|
| | 3-Methyl-4-isoxazolecarboxylic acid Basic information |
| | 3-Methyl-4-isoxazolecarboxylic acid Chemical Properties |
| Melting point | 185-187°C | | Boiling point | 303.6±22.0 °C(Predicted) | | density | 1.348±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | DMSO (Slightly) | | form | Solid | | pka | 2.90±0.25(Predicted) | | color | Brown | | BRN | 114157 | | InChI | InChI=1S/C5H5NO3/c1-3-4(5(7)8)2-9-6-3/h2H,1H3,(H,7,8) | | InChIKey | YBLSBWHFPXDRHC-UHFFFAOYSA-N | | SMILES | O1C=C(C(O)=O)C(C)=N1 | | CAS DataBase Reference | 17153-20-7(CAS DataBase Reference) |
| Provider | Language |
|
ALFA
| English |
| | 3-Methyl-4-isoxazolecarboxylic acid Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powder | | Uses | An impurity in Leflunomide (L322750). |
| | 3-Methyl-4-isoxazolecarboxylic acid Preparation Products And Raw materials |
|