- METCONAZOLE
-
- $1.00 / 1KG
-
2020-01-09
- CAS:125116-23-6
- Min. Order: 1KG
- Purity: 98% HPLC
- Supply Ability: 10 tons/month
|
| | METCONAZOLE Basic information |
| Product Name: | METCONAZOLE | | Synonyms: | 5-(4-CHLOROPHENYLMETHYL)-2,2-DIMETHYL-1-(1H-1,2,4-TRIAZOL-1-YLMETHYL)CYCLOPENTANOL;METCONAZOLE;CARAMBA;(1RS,5RS;1RS,5RS)-5-(4-chlorobenzyl)-2,2-dimethyl-1-(1H-1,2,4-triazol-1-ylmethyl)cyclopentanol;Cyclopentanol, 5-(4-chlorophenyl)methyl-2,2-dimethyl-1-(1H-1,2,4-triazol-1-ylmethyl)-;metconazole (bsi,pa iso);metaconazole | | CAS: | 125116-23-6 | | MF: | C17H22ClN3O | | MW: | 319.83 | | EINECS: | | | Product Categories: | | | Mol File: | 125116-23-6.mol |  |
| | METCONAZOLE Chemical Properties |
| Melting point | 111.5°C | | Boiling point | 285°C (rough estimate) | | density | 1.1888 (rough estimate) | | refractive index | 1.5800 (estimate) | | storage temp. | -20°C | | solubility | Chloroform (Slightly), Dichloromethane (Slightly), Methanol (Slightly) | | pka | 13.82±0.60(Predicted) | | BRN | 8333708 | | InChI | InChI=1S/C17H22ClN3O/c1-16(2)8-7-14(9-13-3-5-15(18)6-4-13)17(16,22)10-21-12-19-11-20-21/h3-6,11-12,14,22H,7-10H2,1-2H3 | | InChIKey | XWPZUHJBOLQNMN-UHFFFAOYSA-N | | SMILES | C1(CN2C=NC=N2)(O)C(CC2=CC=C(Cl)C=C2)CCC1(C)C | | EPA Substance Registry System | Metconazole (125116-23-6) |
| Hazard Codes | Xn,N | | Risk Statements | 22-51/53 | | Safety Statements | 60 | | RIDADR | UN3077 9/PG 3 | | WGK Germany | 2 |
| | METCONAZOLE Usage And Synthesis |
| Chemical Properties | Yerba Mate pure product (cis- and trans- mixture) is white, odorless crystalline solid with high cis- activity. Melting point 110~113℃, boiling point about 285℃. Relative density 1.307(20°C), vapor pressure 1.23×10-5Pa(20°C). Partition coefficient Kow lgP= 3.85 (25°C). Solubility (20℃): water 15mg/L, methanol 235g/L, acetone 238.9g/L. Good thermal and hydrolytic stability. | | Uses | Metconazole is an conazole based fungicide used for the control of black sigatoka disease on banana. Metconazole acts primarily as an inhibitor of ergosterol biosynthesis which interferes with the syn
thesis of fungal cell membranes. | | Definition | ChEBI: A member of the class of cyclopentanols carrying 1,2,4-triazol-1-ylmethyl and 4-chlorobenzyl and geminal dimethyl substituents at positions 1, 2 and 5 respectively. Used to control a range of fungal infections including alternaria, rusts, fusarium and sept
ria diseases. |
| | METCONAZOLE Preparation Products And Raw materials |
|