| Company Name: |
Labnetwork lnc. |
| Tel: |
+86-27-50766799 +86-18062016861 |
| Email: |
contact@labnetwork.com |
|
| | [(1S)-1-(4-Chlorophenyl)ethyl]methylamine Basic information |
| Product Name: | [(1S)-1-(4-Chlorophenyl)ethyl]methylamine | | Synonyms: | [(S)-1-(4-CHLOROPHENYL)ETHYL]METHYLAMINE;Benzenemethanamine, 4-chloro-N,α-dimethyl-, (αS)-;(S)-1-(4-chlorophenyl)-N-methylethanamine;(S)-1-(4-chlorophenyl)-N-methylethan-1-amine;[(1S)-1-(4-Chlorophenyl)ethyl]methylamine | | CAS: | 66399-57-3 | | MF: | C9H12ClN | | MW: | 169.65 | | EINECS: | | | Product Categories: | | | Mol File: | 66399-57-3.mol | ![[(1S)-1-(4-Chlorophenyl)ethyl]methylamine Structure](CAS/20180531/GIF/66399-57-3.gif) |
| | [(1S)-1-(4-Chlorophenyl)ethyl]methylamine Chemical Properties |
| Boiling point | 219.200±15.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.059±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | pka | 9.526±0.10(predicted) | | InChI | InChI=1/C9H12ClN/c1-7(6-11)8-2-4-9(10)5-3-8/h2-5,7H,6,11H2,1H3/t7-/s3 | | InChIKey | FLACJAGRDZAFJF-KPOCXSGKNA-N | | SMILES | NC[C@H](C1=CC=C(Cl)C=C1)C |&1:2,r| |
| | [(1S)-1-(4-Chlorophenyl)ethyl]methylamine Usage And Synthesis |
| | [(1S)-1-(4-Chlorophenyl)ethyl]methylamine Preparation Products And Raw materials |
|