| Company Name: |
Wuxi AppTec |
| Tel: |
022-59987777 13552403979 |
| Email: |
jia_guoqiang@wuxiapptec.com |
(R)-tert-butyl (1-(4-bromophenyl)-2-hydroxyethyl)carbamate manufacturers
|
| | (R)-tert-butyl (1-(4-bromophenyl)-2-hydroxyethyl)carbamate Basic information |
| Product Name: | (R)-tert-butyl (1-(4-bromophenyl)-2-hydroxyethyl)carbamate | | Synonyms: | (R)-tert-butyl (1-(4-bromophenyl)-2-hydroxyethyl)carbamate;Boc-(R)-1-(4-bromophenyl)-2-hydroxyethanamine;tert-butyl N-[(1R)-1-(4-bromophenyl)-2-hydroxyethyl]carbamate;Carbamic acid, N-[(1R)-1-(4-bromophenyl)-2-hydroxyethyl]-, 1,1-dimethylethyl ester;(R)-2-(4-Bromophenyl)-2-(Boc-amino)ethanol;(R)-tert-Butyl (1-(4-bromophenyl)-2-hydroxyethyl)carbamate ee;tert-Butyl (R)-(1-(4-bromophenyl)-2-hydroxyethyl)carbamate | | CAS: | 849178-85-4 | | MF: | C13H18BrNO3 | | MW: | 316.19 | | EINECS: | | | Product Categories: | | | Mol File: | 849178-85-4.mol |  |
| | (R)-tert-butyl (1-(4-bromophenyl)-2-hydroxyethyl)carbamate Chemical Properties |
| Boiling point | 438.3±40.0 °C(Predicted) | | density | 1.365±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 11.43±0.46(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C13H18BrNO3/c1-13(2,3)18-12(17)15-11(8-16)9-4-6-10(14)7-5-9/h4-7,11,16H,8H2,1-3H3,(H,15,17)/t11-/m0/s1 | | InChIKey | QFKIGDYLKNXDFN-NSHDSACASA-N | | SMILES | C(OC(C)(C)C)(=O)N[C@H](C1=CC=C(Br)C=C1)CO |
| | (R)-tert-butyl (1-(4-bromophenyl)-2-hydroxyethyl)carbamate Usage And Synthesis |
| | (R)-tert-butyl (1-(4-bromophenyl)-2-hydroxyethyl)carbamate Preparation Products And Raw materials |
|