| Company Name: |
Xi'an Confluore Biological Technology Co., Ltd. Gold
|
| Tel: |
+86-156-80926068 +86-15680926068 |
| Email: |
1924344760@qq.com |
| Products Intro: |
Product Name:Cyanine5 DBCO
CAS:2182601-71-2
Purity:99% HPLC Package:10MG;25MG;50MG;100MG;1G;5G
|
| Company Name: |
Jiaxing Deyi Chemical Co., Ltd.
|
| Tel: |
86-0573-85866609 13325730825 |
| Email: |
945717149@qq.com |
| Products Intro: |
Product Name:Cyanine5DBCO
CAS:2182601-71-2
Purity:98% Package:1mg；5mg；25mg；50mg；100mg
|
Cyanine5 DBCO manufacturers
- Cyanine5 DBCO
-
- $0.00 / 1mg
-
2025-06-07
- CAS:2182601-71-2
- Min. Order: 1mg
- Purity: >99.00%
- Supply Ability: 10
|
| | Cyanine5 DBCO Basic information |
| Product Name: | Cyanine5 DBCO | | Synonyms: | Cyanine5 DBCO;2-[5-[1-[6-[[3-(11,12-Didehydrodibenz[b,f]azocin-5(6H)-yl)-3-oxopropyl]amino]-6-oxohexyl]-1,3-dihydro-3,3-dimethyl-2H-indol-2-ylidene]-1,3-pentadien-1-yl]-1,3,3-trimethyl-3H-indolium | | CAS: | 2182601-71-2 | | MF: | C50H53N4O2+ | | MW: | 742 | | EINECS: | | | Product Categories: | | | Mol File: | 2182601-71-2.mol |  |
| | Cyanine5 DBCO Chemical Properties |
| solubility | good in DMF, DMSO, chlorinated organic solvents, practically insoluble in water (<1 uM, < 1 mg/L) | | form | powder | | Appearance | dark blue solid | | InChIKey | IWKWVRXEKCOQTG-UHFFFAOYSA-O | | SMILES | C(N1C(C(C)(C)C2=CC=CC=C12)=CC=CC=CC1C(C2=CC=CC=C2[N+]=1C)(C)C)CCCCC(=O)NCCC(N1CC2=CC=CC=C2C#CC2=CC=CC=C12)=O |
| | Cyanine5 DBCO Usage And Synthesis |
| Description | A derivative of Cyanine5 red-emitting fluorophore possessing DBCO (dibenzocyclooctyne, also known as ADIBO, azodibenzocyclooctyne) group for copper free click chemistry.
Strained cycloalkynes, such as cyclooctynes, react with azides very rapidly in the absence of copper catalyst in a strain-promoted alkyne-azide cycloaddition (SPAAC). This reaction is very fast, mild, and biocompatible.
Compared to other cycloalkynes, DBCO provide among the fastest reaction kinetics, still possessing good stability. | | Abs/Em Maxima | 646/662 nm | | Fluoresene quantum yield | 0.2 | | Extinction Coefficient | 250000 |
| | Cyanine5 DBCO Preparation Products And Raw materials |
|