| Company Name: |
Nanjing discovery pharma Technology Co., Ltd Gold
|
| Tel: |
18651673534 18651673534 |
| Email: |
1791871935@qq.com |
| Products Intro: |
Product Name:tert-butyl 2-(azetidin-3-yl)acetate;hydrochloride
CAS:2173991-98-3
Purity:97% HPLC Package:1g;5g;10g;25g;1kg
|
| Company Name: |
PharmaBlock Sciences (Nanjing),Inc.
|
| Tel: |
025-86918202 4000255188 |
| Email: |
sales@pharmablock.com |
| Products Intro: |
Product Name:tert-butyl 2-(azetidin-3-yl)acetate hydrochloride
CAS:2173991-98-3
Purity:97 Package:100MG;250MG;1G;5G;10G;25G
|
|
| | tert-butyl 2-(azetidin-3-yl)acetate hydrochloride Basic information | | Application |
| | tert-butyl 2-(azetidin-3-yl)acetate hydrochloride Chemical Properties |
| InChI | InChI=1S/C9H17NO2.ClH/c1-9(2,3)12-8(11)4-7-5-10-6-7;/h7,10H,4-6H2,1-3H3;1H | | InChIKey | CTWASOKSIVZFFX-UHFFFAOYSA-N | | SMILES | O(C(=O)CC1CNC1)C(C)(C)C.Cl |
| | tert-butyl 2-(azetidin-3-yl)acetate hydrochloride Usage And Synthesis |
| Application | 2-(azacyclobutane-3-yl)tert-butyl acetate hydrochloride can be used as a pharmaceutical intermediate and has wide applications in medicinal chemistry and organic synthesis. |
| | tert-butyl 2-(azetidin-3-yl)acetate hydrochloride Preparation Products And Raw materials |
|