|
|
| | Polaprezinc Impurity 3 Basic information |
| Product Name: | Polaprezinc Impurity 3 | | Synonyms: | Polaprezinc Impurity 3;2-((2-Carboxyethyl)carbamoyl)benzoic acid;carboxyethyl)carbamoyl)benzoic acid;Benzoic acid, 2-[[(2-carboxyethyl)amino]carbonyl]- | | CAS: | 103646-38-4 | | MF: | C11H11NO5 | | MW: | 237.21 | | EINECS: | | | Product Categories: | | | Mol File: | 103646-38-4.mol |  |
| | Polaprezinc Impurity 3 Chemical Properties |
| Melting point | 115-116 °C | | Boiling point | 555.9±35.0 °C(Predicted) | | density | 1.395±0.06 g/cm3(Predicted) | | pka | 3.48±0.36(Predicted) | | InChI | InChI=1S/C11H11NO5/c13-9(14)5-6-12-10(15)7-3-1-2-4-8(7)11(16)17/h1-4H,5-6H2,(H,12,15)(H,13,14)(H,16,17) | | InChIKey | WHTKKIHBHVDWGK-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=CC=C1C(NCCC(O)=O)=O |
| | Polaprezinc Impurity 3 Usage And Synthesis |
| | Polaprezinc Impurity 3 Preparation Products And Raw materials |
|