| Company Name: |
Shanghai GaoLang Chemical Technology Co., Ltd. Gold
|
| Tel: |
021-57340939 18017297327 |
| Email: |
sales@gaolangchemical.com |
| Products Intro: |
Product Name:Vardenafil Impurity 5
CAS:927690-90-2
Purity:98.00% Package:50KG;25KG;5KG;1KG
|
|
| | Vardenafil Impurity 5 Basic information | | Uses |
| Product Name: | Vardenafil Impurity 5 | | Synonyms: | Vardenafil Impurity 19;VardefilImpurity5;N-{1-[3-(2-ethoxyphenyl)-5-oxo-4,5-dihydro-[1,2,4]triazin-6-yl]ethyl}butyroamide;Vardenafil Impurity 21;Butanamide, N-[1-[3-(2-ethoxyphenyl)-2,5-dihydro-5-oxo-1,2,4-triazin-6-yl]ethyl]-;N-(1-(3-(2-Ethoxyphenyl)-5-oxo-4,5-dihydro-1,2,4-triazin-6-yl)ethyl)butyramide;N-1- [3- (2-ethoxyphenyl) -5-oxo-4,5-dihydro - [1,2,4- triazine-6-yl] ethylbutanamide) | | CAS: | 927690-90-2 | | MF: | C17H22N4O3 | | MW: | 330.38 | | EINECS: | | | Product Categories: | | | Mol File: | 927690-90-2.mol |  |
| | Vardenafil Impurity 5 Chemical Properties |
| density | 1.23±0.1 g/cm3(Predicted) | | pka | 8.86±0.40(Predicted) | | InChI | InChI=1S/C17H22N4O3/c1-4-8-14(22)18-11(3)15-17(23)19-16(21-20-15)12-9-6-7-10-13(12)24-5-2/h6-7,9-11H,4-5,8H2,1-3H3,(H,18,22)(H,19,21,23) | | InChIKey | PSQIKSBMRFTURW-UHFFFAOYSA-N | | SMILES | C(NC(C1=NNC(C2=CC=CC=C2OCC)=NC1=O)C)(=O)CCC |
| | Vardenafil Impurity 5 Usage And Synthesis |
| Uses | N-1-(3-(2-ethoxyphenyl)-5-oxo-4,5-2H-1,2,4-triazine-6-yl)ethyl)butyramide is an impurity of vardenafil, used as an impurity standard and reference. |
| | Vardenafil Impurity 5 Preparation Products And Raw materials |
|