- Melengestrol acetate
-
- $0.00 / 100g
-
2026-01-09
- CAS:2919-66-6
- Min. Order: 100g
- Purity: 98.0~101.0%
- Supply Ability: 100kg/month
- Melengestrol acetate
-
- $46.00 / 1mL
-
2026-01-05
- CAS:2919-66-6
- Min. Order:
- Purity: 98.68%
- Supply Ability: 10g
- Melengestrol acetate
-
- $0.00 / 1KG
-
2026-01-03
- CAS:2919-66-6
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 5000
|
| | Melengestrol acetate Basic information |
| Product Name: | Melengestrol acetate | | Synonyms: | 20-dione,17-(acetyloxy)-6-methyl-16-methylene-pregna-6-diene-3;6-dehydro-16-methylene-6-methyl-17-acetoxyprogesterone;6-diene-3,20-dione,17-hydroxy-6-methyl-16-methylene-pregna-acetate;5373;NSC-70968;17-(Acetyloxy)-6-methyl-16-methylenepregna-4,6-diene-3,20-dione;17-Hydroxy-6-methyl-16-methylenepregna-4,6-diene-3, 20-dione acetate;6-Methyl-16-methylene-3,20-dioxopregna-4,6-dien-17-yl acetate | | CAS: | 2919-66-6 | | MF: | C25H32O4 | | MW: | 396.52 | | EINECS: | 220-859-7 | | Product Categories: | Intermediates & Fine Chemicals;Pharmaceuticals;Steroid and Hormone;Steroids;Hormone | | Mol File: | 2919-66-6.mol |  |
| | Melengestrol acetate Chemical Properties |
| Melting point | 202-204 °C(lit.) | | alpha | D23 -127° (c = 0.31 in chloroform) | | Boiling point | 440.2°C (rough estimate) | | density | 1.0911 (rough estimate) | | refractive index | 1.6000 (estimate) | | storage temp. | 0-6°C | | solubility | Chloroform (Sparingly), Ethyl Acetate (Slightly), Methanol (Slightly) | | form | Solid | | color | Off-White to Beige | | BRN | 2066919 | | InChIKey | UDKABVSQKJNZBH-DWNQPYOZSA-N | | SMILES | C1(=O)C=C2[C@](C)(CC1)[C@]1([H])[C@]([H])([C@@]3([H])[C@@](CC1)(C)[C@@](OC(C)=O)(C(=O)C)C(=C)C3)C=C2C | | CAS DataBase Reference | 2919-66-6(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 62 | | Safety Statements | 36 | | WGK Germany | 3 | | RTECS | TU4141000 | | HS Code | 29372390 | | Toxicity | LD50 (mg/kg): >8000 orally in rats; >2500 i.p. in mice (Zimbelman) |
| | Melengestrol acetate Usage And Synthesis |
| Chemical Properties | Light Tan Solid | | Uses | antiarrhythmic, cardiotonic, hypertensive, Na/K ATPase inhibitor | | Uses | Melengestrol Acetate is an orally active progestational steroid. Progestogen; growth promotant. | | Definition | ChEBI: Melengestrol acetate is a corticosteroid hormone. | | Safety Profile | An experimental
teratogen. Experimental reproductive
effects. When heated to decomposition it
yields acrid smoke and irritating fumes. | | Toxics Screening Level | The initial threshold screening level (ITSL) for melengesterol acetate is 2 μg/m3 based on an annual averaging time. |
| | Melengestrol acetate Preparation Products And Raw materials |
|