| Company Name: |
Santai Labs, Inc.
|
| Tel: |
519-85601385 |
| Email: |
marketing@santailabs.com |
| Products Intro: |
Product Name:5-Bromo-1,3-thiazole-4-carbaldehyde CAS:934346-19-7 Purity:97% HPLC Package:25G;100G;1kg;25kg
|
| Company Name: |
SHANGHAI FDC-CHEMICAL CO.,LTD
|
| Tel: |
021-61469567 13774476675 |
| Email: |
sales@fdc-chemical.com |
| Products Intro: |
Product Name:5-Bromothiazole-4-carbaldehyde CAS:934346-19-7 Purity:95% Package:1g;5g;25g
|
| Company Name: |
Amel Pharmatech Corporation
|
| Tel: |
027-888-4366503 13986279625 |
| Email: |
sales@amelpharmatech.com |
| Products Intro: |
Product Name:5-Bromo-1,3-thiazole-4-carbaldehyde CAS:934346-19-7 Purity:95% Package:g; kg
|
|
| | 5-Bromo-1,3-thiazole-4-carbaldehyde Basic information |
| | 5-Bromo-1,3-thiazole-4-carbaldehyde Chemical Properties |
| Boiling point | 279.1±20.0 °C(Predicted) | | density | 1.920±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, stored under nitrogen | | pka | -1.21±0.10(Predicted) | | Appearance | Off-white to light brown Solid | | InChI | InChI=1S/C4H2BrNOS/c5-4-3(1-7)6-2-8-4/h1-2H | | InChIKey | GWUBJUUGUUFJNW-UHFFFAOYSA-N | | SMILES | S1C(Br)=C(C=O)N=C1 |
| | 5-Bromo-1,3-thiazole-4-carbaldehyde Usage And Synthesis |
| | 5-Bromo-1,3-thiazole-4-carbaldehyde Preparation Products And Raw materials |
|