|
|
| Product Name: | wu | | Synonyms: | PLX51109;PXL51107;PLX51107;PLX51107;PLX 51107;PLX-51107;CS-2690;PXL 51107 ;PXL-51107;4-[6-(3,5-Dimethyl-4-isoxazolyl)-1-[(1S)-1-(2-pyridinyl)ethyl]-1H-pyrrolo[3,2-b]pyridin-3-yl]benzoic Acid;Benzoic acid, 4-[6-(3,5-dimethyl-4-isoxazolyl)-1-[(1S)-1-(2-pyridinyl)ethyl]-1H-pyrrolo[3,2-b]pyridin-3-yl]- | | CAS: | 1627929-55-8 | | MF: | C26H22N4O3 | | MW: | 438.48 | | EINECS: | | | Product Categories: | | | Mol File: | 1627929-55-8.mol |  |
| Melting point | >270°C (dec.) | | Boiling point | 683.3±55.0 °C(Predicted) | | density | 1.32±0.1 g/cm3(Predicted) | | storage temp. | -20°C Freezer | | solubility | DMSO (Slightly, Heated) | | pka | 3.68±0.10(Predicted) | | form | Solid | | color | White to Off-White | | InChIKey | AMSUHYUVOVCWTP-INIZCTEOSA-N | | SMILES | C(O)(=O)C1=CC=C(C2C3=NC=C(C4=C(C)ON=C4C)C=C3N([C@H](C3=NC=CC=C3)C)C=2)C=C1 |
| Uses | 4-[6-(3,5-Dimethyl-4-isoxazolyl)-1-[(1S)-1-(2-pyridinyl)ethyl]-1H-pyrrolo[3,2-b]pyridin-3-yl]benzoic Acid, is a potent and selective BET inhibitor. | | in vivo | PLX51107 (2 mg/kg, p.o.) inhibits splenomegaly by 75% in the Ba/F3 (murine IL3-dependent pro-B-cell line) splenomegaly mouse model, with the similar effect of 25 mg/kg OTX015. PLX51107 (20 mg/kg, qd, p.o.) exhibits potent antileukemic effects in disease models of aggressive chronic lymphocytic leukemia (CLL) and Richter transformation (RT) via oral administration once daily[1]. |
| | wu Preparation Products And Raw materials |
|