| Company Name: |
CHIRIAL CO.LTD Gold
|
| Tel: |
+86-025-58218501; 19941513806 |
| Email: |
sales@chirial.com |
| Products Intro: |
Product Name:tert-butyl (3S,4R)-3-amino-4-hydroxy-piperidine-1-carboxylate
CAS:1820579-78-9
Purity:≥97% Package:1kg
|
|
| | tert-butyl (3S,4R)-3-amino-4-hydroxypiperidine-1-carboxylate Basic information |
| Product Name: | tert-butyl (3S,4R)-3-amino-4-hydroxypiperidine-1-carboxylate | | Synonyms: | tert-butyl (3S,4R)-3-amino-4-hydroxypiperidine-1-carboxylate;1-Piperidinecarboxylic acid, 3-amino-4-hydroxy-, 1,1-dimethylethyl ester, (3S,4R)-;CPD3638;(3S,4R)-tert-Butyl 3-amino-4-hydroxypiperidine-1-carboxylate;(3S,4R)-1-Boc-3-amino-4-hydroxypiperidine;(3S,4R)-3-Amino-4-hydroxypiperidine-1-carboxylic acid tert-butyl ester | | CAS: | 1820579-78-9 | | MF: | C10H20N2O3 | | MW: | 216.28 | | EINECS: | | | Product Categories: | | | Mol File: | 1820579-78-9.mol |  |
| | tert-butyl (3S,4R)-3-amino-4-hydroxypiperidine-1-carboxylate Chemical Properties |
| Boiling point | 326.1±42.0 °C(Predicted) | | density | 1.142±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | pka | 14.44±0.40(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C10H20N2O3/c1-10(2,3)15-9(14)12-5-4-8(13)7(11)6-12/h7-8,13H,4-6,11H2,1-3H3/t7-,8+/m0/s1 | | InChIKey | LUQURLQDYAJECW-JGVFFNPUSA-N | | SMILES | N1(C(OC(C)(C)C)=O)CC[C@@H](O)[C@@H](N)C1 |
| | tert-butyl (3S,4R)-3-amino-4-hydroxypiperidine-1-carboxylate Usage And Synthesis |
| | tert-butyl (3S,4R)-3-amino-4-hydroxypiperidine-1-carboxylate Preparation Products And Raw materials |
|