4-Chloro-3-nitrobenzoyl chloride manufacturers
|
| | 4-Chloro-3-nitrobenzoyl chloride Basic information |
| | 4-Chloro-3-nitrobenzoyl chloride Chemical Properties |
| Melting point | 47-54 °C(lit.) | | Boiling point | 301.7±22.0 °C(Predicted) | | density | 1.5741 (rough estimate) | | refractive index | 1.6140 (estimate) | | Fp | 230 °F | | storage temp. | Inert atmosphere,2-8°C | | solubility | Chloroform (Slightly) | | form | powder | | color | White | | Stability: | Stable, but may be air and moisture sensitive. Incompatible with strong oxidizing agents. | | InChI | 1S/C7H3Cl2NO3/c8-5-2-1-4(7(9)11)3-6(5)10(12)13/h1-3H | | InChIKey | IWLGXPWQZDOMSB-UHFFFAOYSA-N | | SMILES | [O-][N+](=O)c1cc(ccc1Cl)C(Cl)=O | | CAS DataBase Reference | 38818-50-7(CAS DataBase Reference) | | NIST Chemistry Reference | 4-Chloro-3-nitrobenzoyl chloride(38818-50-7) |
| Hazard Codes | C | | Risk Statements | 34-21 | | Safety Statements | 26-27-36/37/39-45-25 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29163900 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | 4-Chloro-3-nitrobenzoyl chloride Usage And Synthesis |
| Chemical Properties | powder or crystals | | Uses | 4-Chloro-3-nitrobenzoyl chloride may be employed as acylation reagent for the Friedel-Crafts acylation of activated benzenes such as anisole, veratrole and 1,4-dimethoxybenzene. It may be employed for the synthesis of 4-chloro-4-methoxy-3-nitrobenzophenone. It may be employed as acylation reagent for the acylation reaction of the deactivated amines (2- aminopyrimidine, aminopyrazine). | | General Description | 4-Chloro-3-nitrobenzoyl chloride is an acid halide. |
| | 4-Chloro-3-nitrobenzoyl chloride Preparation Products And Raw materials |
|