- FMOC-D-alanine
-
- $0.00 / 25Kg/Drum
-
2026-05-19
- CAS:79990-15-1
- Min. Order: 1KG
- Purity: 98%min
- Supply Ability: 500kgs
- Fmoc-D-Ala-OH
-
- $0.00/ kg
-
2026-05-19
- CAS:79990-15-1
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T
|
| | FMOC-D-alanine Basic information |
| | FMOC-D-alanine Chemical Properties |
| Melting point | 151-155 °C | | alpha | 18.3 º (c=1,DMF) | | Boiling point | 544.1±33.0 °C(Predicted) | | density | 1.282±0.06 g/cm3(Predicted) | | refractive index | 19 ° (C=1, DMF) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | DMF (Slightly), DMSO (Slightly), Methanol (Slightly) | | pka | 3.91±0.10(Predicted) | | form | Solid | | color | White to Off-White | | Optical Rotation | [α]20/D +18.5±1°, c = 1% in DMF | | Water Solubility | Soluble in dimethylformamide (1 mole in 2 ml). Insoluble in water. | | BRN | 8025133 | | Major Application | peptide synthesis | | InChI | 1S/C18H17NO4/c1-11(17(20)21)19-18(22)23-10-16-14-8-4-2-6-12(14)13-7-3-5-9-15(13)16/h2-9,11,16H,10H2,1H3,(H,19,22)(H,20,21)/t11-/m1/s1 | | InChIKey | QWXZOFZKSQXPDC-LLVKDONJSA-N | | SMILES | C[C@@H](NC(=O)OCC1c2ccccc2-c3ccccc13)C(O)=O | | CAS DataBase Reference | 79990-15-1(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29224999 | | Storage Class | 11 - Combustible Solids |
| | FMOC-D-alanine Usage And Synthesis |
| Chemical Properties | White solid | | Uses | N-Fmoc-D-alanine is potentially useful for proteomics studies and solid phase peptide synthesis techniques. It is also essential for the biosynthesis of peptidoglycan cross linking sub-units that are used for bacterial cell walls. | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis | | Synthesis | For the synthesis of Fmoc-D-alanine, the conventional synthetic method is to start from D-alanine and obtain the target product through an amine ester exchange reaction with the precursor compound ester. Generally, the reaction requires the addition of a small amount of weak base to promote the reaction and needs to be carried out at high temperature. |
| | FMOC-D-alanine Preparation Products And Raw materials |
|