| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 5-Oxo-1-phenyl-2-pyrazolin-3-carboxylic acid Basic information |
| | 5-Oxo-1-phenyl-2-pyrazolin-3-carboxylic acid Chemical Properties |
| Melting point | 237 °C (lit.) | | Boiling point | 375.1±25.0 °C(Predicted) | | density | 1.41±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | pka | -2.53±0.20(Predicted) | | form | solid | | Appearance | Light brown to brown Solid | | InChI | 1S/C10H8N2O3/c13-9-6-8(10(14)15)11-12(9)7-4-2-1-3-5-7/h1-5H,6H2,(H,14,15) | | InChIKey | IMZSHPUSPMOODC-UHFFFAOYSA-N | | SMILES | OC(=O)C1=NN(C(=O)C1)c2ccccc2 | | CAS DataBase Reference | 119-18-6(CAS DataBase Reference) |
| Hazard Codes | Xi | | Safety Statements | 24/25 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29331990 | | Storage Class | 11 - Combustible Solids |
| | 5-Oxo-1-phenyl-2-pyrazolin-3-carboxylic acid Usage And Synthesis |
| Chemical Properties | light yellow crystalline | | Uses | Reactant involved in synthesis of:
- Pyrazolone derivatives for antiprion activity via heterocyclocondensation
- Heterocyclic thiazolidinone and azetidinone compound for antibacterial studies
|
| | 5-Oxo-1-phenyl-2-pyrazolin-3-carboxylic acid Preparation Products And Raw materials |
|