|
|
| | 4-Hydroxy-2-methylquinoline Basic information |
| | 4-Hydroxy-2-methylquinoline Chemical Properties |
| Melting point | 234-236 °C(lit.) | | Boiling point | 284.68°C (rough estimate) | | density | 1.1202 (rough estimate) | | refractive index | 1.6070 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystal | | pka | 4.44±0.40(Predicted) | | color | White to Light yellow | | Water Solubility | Slightly soluble in water. | | λmax | 317nm(CHCl3)(lit.) | | BRN | 118320 | | InChI | InChI=1S/C10H9NO/c1-7-6-10(12)8-4-2-3-5-9(8)11-7/h2-6H,1H3,(H,11,12) | | InChIKey | NWINIEGDLHHNLH-UHFFFAOYSA-N | | SMILES | N1C2C(=CC=CC=2)C(O)=CC=1C | | LogP | 1.902 (est) | | CAS DataBase Reference | 607-67-0(CAS DataBase Reference) | | NIST Chemistry Reference | 4-Quinolinol, 2-methyl-(607-67-0) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39-36/37/39-22 | | WGK Germany | 3 | | HS Code | 29334900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 4-Hydroxy-2-methylquinoline Usage And Synthesis |
| Chemical Properties | BEIGE POWDER | | Uses | 4-Hydroxy-2-methylquinoline is act as an intermediate in the synthesis of dequalinium chloride and as pharmaceutical intermediate. | | Uses | 4-Hydroxy-2-methylquinoline can be used as an intermediate in the synthesis of a wide range of medicinally important compounds such as:
- Synthesis of 2-(quinolin-4-yloxy)acetamides as potent antitubercular agents.
- Synthesis of 2-arylethenylquinoline derivatives for the treatment of Alzheimer′s disease.
- Synthesis of 1,10-diethoxy-1H-pyrano[4,3-b]quinolones as antibacterial agents.
- Synthesis of phenylimidazole-pyrazolo[1,5-c]quinazolines as potent phophodiesterase 10A (PDE10A) inhibitors.
| | Definition | ChEBI: 2-Methyl-4-quinolinol is a member of quinolines. |
| | 4-Hydroxy-2-methylquinoline Preparation Products And Raw materials |
|