| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | (R)-(+)-2,2',6,6'-Tetramethoxy-4,4'-bis(diphenylphosphino)-3,3'-bipyridine Basic information | | Reaction |
| Product Name: | (R)-(+)-2,2',6,6'-Tetramethoxy-4,4'-bis(diphenylphosphino)-3,3'-bipyridine | | Synonyms: | (S)-(-)-2,2',6,6'-TETRAMETHOXY-4,4'-BIS(DIPHENYLPHOSPHINO)-3,3-BIPYRIDINE;CTH-(S)-P-PHOS;(3S)-4,4'-Bis(diphenylphosphino)-2,2',6,6'-tetramethoxy-3,3'-bipyridine;(R)-P-PHOS;(R)-(-)-2,2',6,6'-TETRAMETHOXY-4,4'-BIS(DIPHENYLPHOSPHINO)-3,3'-BIPYRIDINE;95+%cth-(s)-p-phos;(S)-(-)-2,2',6,6'-Tetramethoxy-4,4'-bis(diphenylphosphino)-3,3'-bipyridine,min.95%CTH-(S)-P-PHOS;(s)-(-)-2,2',6,6'-tetramethoxy-4,4'-bis(diphenylphosphino)-3,3'-bipyridine *cth-(s)-p-phos* | | CAS: | 362524-23-0 | | MF: | C38H34N2O4P2 | | MW: | 644.64 | | EINECS: | | | Product Categories: | | | Mol File: | 362524-23-0.mol |  |
| | (R)-(+)-2,2',6,6'-Tetramethoxy-4,4'-bis(diphenylphosphino)-3,3'-bipyridine Chemical Properties |
| Melting point | 261-265°C | | Boiling point | 686.1±55.0 °C(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | Powder | | pka | -2.99±0.20(Predicted) | | color | white to pale yellow | | Optical Rotation | [α]20/D -98°, c = 1 in chloroform | | InChIKey | JZOSBBLJKXSBBN-UHFFFAOYSA-N | | SMILES | COc1cc(P(c2ccccc2)c3ccccc3)c(c(OC)n1)-c4c(OC)nc(OC)cc4P(c5ccccc5)c6ccccc6 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38-37 | | Safety Statements | 26-36/37/39 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| Provider | Language |
|
ALFA
| English |
| | (R)-(+)-2,2',6,6'-Tetramethoxy-4,4'-bis(diphenylphosphino)-3,3'-bipyridine Usage And Synthesis |
| Reaction | New class of highly effective chiral dipyridylphosphine ligands used in the asymmetric hydrogenation of 2-arylacrylic acids, β-ketoesters, and aryl ketones.

| | Chemical Properties | White solid | | Uses | (S)-P-Phos can be used as a ligand:
- In the asymmetic hydrogenation reactions.
- For the preparation of chiral ketone functionalized polymers by copolymerization reaction.
- To synthesize chiral alkynes by asymmetric hydroalkynylation of nonpolar alkenes or norbornadienes using iridium catalyst.
- In the selective allylic alkylation of indoles using palladium catalyst.
|
| | (R)-(+)-2,2',6,6'-Tetramethoxy-4,4'-bis(diphenylphosphino)-3,3'-bipyridine Preparation Products And Raw materials |
|