Methyl Bromopyruvate manufacturers
- Methyl Bromopyruvate
-
- $1.00 / 1KG
-
2019-12-31
- CAS:7425-63-0
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 200kg
|
| | Methyl Bromopyruvate Basic information |
| Product Name: | Methyl Bromopyruvate | | Synonyms: | 3-Bromo-2-oxopropionic acid methyl ester;Methyl broMide acetone;BrCH2COCO2Me;Methyl bromopyruvate, Methyl 3-bromo-2-oxopropionate;Methyl broMopyruvate technical;3-bromo-2-oxoPropanoic acid methyl ester;METHYL BROMOPYRUVATE;METHYL 3-BROMO-2-OXOPROPANOATE | | CAS: | 7425-63-0 | | MF: | C4H5BrO3 | | MW: | 180.98 | | EINECS: | | | Product Categories: | C2 to C5;Carbonyl Compounds;Esters | | Mol File: | 7425-63-0.mol |  |
| | Methyl Bromopyruvate Chemical Properties |
| Melting point | 5°C(lit.) | | Boiling point | 84°C/10mmHg(lit.) | | density | 1.70 g/mL at 20 °C (lit.) | | refractive index | n20/D 1.480 | | Fp | 125 °C | | storage temp. | 2-8°C | | form | clear liquid | | color | Light orange to Yellow to Green | | BRN | 1754888 | | InChI | InChI=1S/C4H5BrO3/c1-8-4(7)3(6)2-5/h2H2,1H3 | | InChIKey | MQONVZMIFQQQHA-UHFFFAOYSA-N | | SMILES | C(OC)(=O)C(=O)CBr | | CAS DataBase Reference | 7425-63-0(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | RIDADR | UN 3334 | | WGK Germany | 3 | | F | 19 | | HS Code | 2918300090 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Methyl Bromopyruvate Usage And Synthesis |
| Chemical Properties | This product has a bp of 82-84°C/133 MPa, n20D of 1.463, a relative density of 1.70, and is soluble in organic solvents. | | Uses | Methyl bromopyruvate was used in the synthesis of 2-(4-amino-4-carboxybutyl)thiazole-4-carboxylic acid and methyl-1-(bromomethyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-1-carboxylate. | | General Description | Methyl bromopyruvate is an inhibitor of carbonic anhydrase. |
| | Methyl Bromopyruvate Preparation Products And Raw materials |
|