|
|
| | 3,3'-Dimethylbenzidine dihydrochloride Basic information |
| Product Name: | 3,3'-Dimethylbenzidine dihydrochloride | | Synonyms: | 4-Piperazin-1-yl-benzenesulfonamide;8-Piperazin-1-yl-quinoline;o-TOLIDINE DIHYDROCHLORIDE REAGENT (ACS);o-Tolidine2HCl;o-Tolidinedihydrochloride,ACS;1,1-Biphenyl-4,4-diamine, 3,3-dimethyl-, dihydrochloride;THALLIUM ARSENATE;3,3μ-Dimethylbenzidine dihydrochloride, 4,4μ-Bianisidine dihydrochloride, 4,4μ-Diamino-3,3μ-dimethylbiphenyl dihydrochloride | | CAS: | 612-82-8 | | MF: | C14H18Cl2N2 | | MW: | 285.21 | | EINECS: | 210-322-5 | | Product Categories: | Biphenyl & Diphenyl ether;Intermediates of Dyes and Pigments | | Mol File: | 612-82-8.mol |  |
| | 3,3'-Dimethylbenzidine dihydrochloride Chemical Properties |
| Melting point | >300°C | | solubility | DMSO (Slightly, Heated), Methanol (Slightly) | | form | Solid | | color | white to light yellow | | Water Solubility | Soluble in water. | | Sensitive | Air Sensitive | | InChI | InChI=1S/C14H16N2.2ClH/c1-9-7-11(3-5-13(9)15)12-4-6-14(16)10(2)8-12;;/h3-8H,15-16H2,1-2H3;2*1H | | InChIKey | LUKPNZHXJRJBAN-UHFFFAOYSA-N | | SMILES | C1(C=CC(N)=C(C)C=1)C1C=CC(N)=C(C)C=1.Cl.Cl | | CAS DataBase Reference | 612-82-8(CAS DataBase Reference) | | EPA Substance Registry System | 3,3'-Dimethylbenzidine dihydrochloride (612-82-8) |
| Hazard Codes | T,N | | Risk Statements | 45-22-51/53-68 | | Safety Statements | 53-45-61 | | RIDADR | UN 3077 9/PG 3 | | WGK Germany | 3 | | RTECS | DD1226000 | | F | 3-8-9 | | TSCA | TSCA listed | | HazardClass | 6.1(b) | | PackingGroup | III | | HS Code | 29215900 |
| | 3,3'-Dimethylbenzidine dihydrochloride Usage And Synthesis |
| Chemical Properties | light beige to grey-beige crystalline powder | | Uses | It is an indicator. | | Uses | o-Tolidine dihydrochloride is used as a sensitive colorimetric reagent for gold and for free chlorine in water. | | General Description | Light tan powder. | | Air & Water Reactions | Soluble in water. | | Reactivity Profile | Acidic organic/inorganic salts, such as 3,3'-Dimethylbenzidine dihydrochloride, are generally soluble in water. The resulting solutions contain moderate to high concentrations of hydrogen ions and have pH's of less than 7.0. They react as acids to neutralize bases. These neutralizations generate heat, but less or far less than is generated by neutralization of inorganic acids, inorganic oxoacids, and carboxylic acid. They usually do not react as either oxidizing agents or reducing agents but such behavior is not impossible. Many of these compounds catalyze organic reactions. | | Fire Hazard | Flash point data for 3,3'-Dimethylbenzidine dihydrochloride are not available, but 3,3'-Dimethylbenzidine dihydrochloride is probably combustible. | | Safety Profile | Suspected carcinogen
with experimental carcinogenic data.
Mutation data reported. When heated to
decomposition it emits very toxic fumes of
HCl and NOx |
| | 3,3'-Dimethylbenzidine dihydrochloride Preparation Products And Raw materials |
|