|
|
| | 1,1'-THIOCARBONYLDI-2(1H)-PYRIDONE Basic information |
| Product Name: | 1,1'-THIOCARBONYLDI-2(1H)-PYRIDONE | | Synonyms: | 1,1'-THIOCARBONYLDI-2(1H)-PYRIDONE;1,1'-Thiocarbonyldi-2(1H)-pyri;1,1′-Thiocarbonyldi-2(1H)-pyridone,97%;1,1'-Thiocarbonyl-di-pyridin-2(1H)-one;1,1'-Thiocarbonyldi-2,2'-pyridone;Thiocarbonyldi[2(1H)-pyridone];1,1μ-Thiocarbonyldi-2(1H)-pyridone;1,1'-Thiocarbonyldi-2(1H)-pyridone 97% | | CAS: | 102368-13-8 | | MF: | C11H8N2O2S | | MW: | 232.26 | | EINECS: | | | Product Categories: | Building Blocks;C11;Chemical Synthesis;Heterocyclic Building Blocks;Heterocyclic Compounds;C9 to C46;Heterocyclic Building Blocks;Pyridines | | Mol File: | 102368-13-8.mol |  |
| | 1,1'-THIOCARBONYLDI-2(1H)-PYRIDONE Chemical Properties |
| Melting point | 163-166 °C(lit.) | | Boiling point | 385.2±25.0 °C(Predicted) | | density | 1.485 | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | form | powder to crystal | | pka | -1.70±0.23(Predicted) | | color | Light yellow to Brown | | InChI | InChI=1S/C11H8N2O2S/c14-9-5-1-3-7-12(9)11(16)13-8-4-2-6-10(13)15/h1-8H | | InChIKey | KXMMNJQMGILZDB-UHFFFAOYSA-N | | SMILES | C(N1C(=O)C=CC=C1)(N1C(=O)C=CC=C1)=S |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | HS Code | 2933.79.8500 |
| | 1,1'-THIOCARBONYLDI-2(1H)-PYRIDONE Usage And Synthesis |
| Uses | 1,1'-Thiocarbonyldi-2(1H)-pyridone is used in the preparation of thio-analogs of thioureas, sulforaphane and 2-furan-2-yl-3-hydroxy-6-isothiocyanato-chromen-4-one. It is involved in the preparation of norbiotinamine and its reactive derivatives such as isothiocyanates. |
| | 1,1'-THIOCARBONYLDI-2(1H)-PYRIDONE Preparation Products And Raw materials |
|