GANODERIC ACID DM manufacturers
- Ganoderic acid DM
-
-
2023-02-24
- CAS:173075-45-1
- Min. Order: 5mg
- Purity: ≥98%(HPLC)
- Supply Ability: 10 g
|
| | GANODERIC ACID DM Basic information |
| Product Name: | GANODERIC ACID DM | | Synonyms: | GANODERIC ACID DM;Gaderic acid DM;Lanosta-8,24-dien-26-oic acid, 3,7-dioxo-, (24E)-;(R,E)-2-methyl-6-((5R,10S,13R,14R,17R)-4,4,10,13,14-pentamethyl-3,7-dioxo-2,3,4,5,6,7,10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)hept-2-enoic acid;(24E)-3,7-Dioxolanosta-8,24-dien-26-oic acid | | CAS: | 173075-45-1 | | MF: | C30H44O4 | | MW: | 468.67 | | EINECS: | | | Product Categories: | Miscellaneous Natural Products | | Mol File: | 173075-45-1.mol |  |
| | GANODERIC ACID DM Chemical Properties |
| storage temp. | -20°C | | solubility | Methanol: soluble | | form | Powder | | color | White to off-white | | InChIKey | ZTKZZRIVAYGFSF-PIPDTRPPSA-N | | SMILES | C1(=O)[C@@]([C@]2([C@](C)(CC1)C1=C([C@]3([C@@](CC1)(C)[C@@H]([C@H](C)CC/C=C(\C)/C(O)=O)CC3)C)C(=O)C2)[H])(C)C |
| | GANODERIC ACID DM Usage And Synthesis |
| Uses | Ganoderic acid DM, a natural triterpenoid isolated from Ganoderma lucidum, induces DNA damage, G1 cell cycle arrest and apoptosis in human breast cancer cells. Ganoderic acid DM as a specific inhibitor of osteoclastogenesis[1][2]. | | Definition | ChEBI: Ganoderic acid DM is a triterpenoid. | | Biological Activity | Ganoderic acid DM is a triterpenoid that has been found in G. lucidum and has diverse biological activities. 1,2,3 It inhibits 5α-reductase and HMG-CoA reductase (IC50s = 10.6 and 9.5 μM, respectively) and binds to the ligand-binding domain of the androgen receptor in a fluorescence polarization assay.1,2 Ganoderic acid suppresses osteoclastogenesis of RAW 264.7 cells when used at a concentration of 12.5 μM and is cytotoxic to K562 leukemia and PC3 prostate cancer cells (IC50s = 18.8 and 81.6 μM, respectively). It reduces ear edema induced by phorbol 12-myristate 13-acetate in mice (ID50 = 0.08 mg/ear).3 | | References | 1.Liu, J., Shiono, J., Shimizu, K., et al.Ganoderic acid DM: Anti-androgenic osteoclastogenesis inhibitorBioorg. Med. Chem. Lett.19(8)2154-2157(2009)
2.Wang, K., Bao, L., Xiong, W., et al.Lanostane triterpenes from the Tibetan medicinal mushroom Ganoderma leucocontextum and their inhibitory effects on HMG-CoA reductase and αglucosidaseJ. Nat. Prod.78(8)1977-1989(2015)
3.Akihisa, T., Nakamura, Y., Tagata, M., et al.Anti-inflammatory and anti-tumor-promoting effects of triterpene acids and sterols from the fungus Ganoderma lucidumChem. Biodivers.4(2)224-231(2007) |
| | GANODERIC ACID DM Preparation Products And Raw materials |
|