|
|
| | ethyl 5-(4-fluorophenyl)-1H-pyrazole-4-carboxylate Basic information |
| | ethyl 5-(4-fluorophenyl)-1H-pyrazole-4-carboxylate Chemical Properties |
| Boiling point | 423.3±35.0 °C(Predicted) | | density | 1.266±0.06 g/cm3(Predicted) | | pka | 10.74±0.50(Predicted) | | form | solid | | InChI | 1S/C12H11FN2O2/c1-2-17-12(16)10-7-14-15-11(10)8-3-5-9(13)6-4-8/h3-7H,2H2,1H3,(H,14,15) | | InChIKey | SMIDIXPTHCPZEZ-UHFFFAOYSA-N | | SMILES | CCOC(C1=CNN=C1C2=CC=C(F)C=C2)=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Chronic 1 Eye Irrit. 2 |
| | ethyl 5-(4-fluorophenyl)-1H-pyrazole-4-carboxylate Usage And Synthesis |
| | ethyl 5-(4-fluorophenyl)-1H-pyrazole-4-carboxylate Preparation Products And Raw materials |
|