|
|
| | 2-Bromo-4,5-difluoroanisole Basic information |
| Product Name: | 2-Bromo-4,5-difluoroanisole | | Synonyms: | 1-Bromo-4,5-difluoro-2-methoxybenzene, 2-Bromo-4,5-difluorophenyl methyl ether;2-Bromo-4,5-difluoroanisole98%;1-BroMo-4,5-difluoro-2-Methoxybenzene;2-BROMO-4,5-DIFLUOROANISOLE;Benzene, 1-bromo-4,5-difluoro-2-methoxy-;2-Bromo-4,5-difluoroanisole ISO 9001：2015 REACH;CAS:202865-58-5 | | CAS: | 202865-58-5 | | MF: | C7H5BrF2O | | MW: | 223.01 | | EINECS: | | | Product Categories: | Aromatic Halides (substituted);Anisoles, Alkyloxy Compounds & Phenylacetates;Bromine Compounds;Fluorine Compounds | | Mol File: | 202865-58-5.mol |  |
| | 2-Bromo-4,5-difluoroanisole Chemical Properties |
| Boiling point | 200.6±35.0 °C(Predicted) | | density | 1.615±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | low melting solid | | color | Colourless | | Water Solubility | Not miscible or difficult to mix with water. | | InChI | InChI=1S/C7H5BrF2O/c1-11-7-3-6(10)5(9)2-4(7)8/h2-3H,1H3 | | InChIKey | DKARISQFDBAJEZ-UHFFFAOYSA-N | | SMILES | C1(Br)=CC(F)=C(F)C=C1OC | | CAS DataBase Reference | 202865-58-5(CAS DataBase Reference) |
| Provider | Language |
|
ALFA
| English |
| | 2-Bromo-4,5-difluoroanisole Usage And Synthesis |
| Uses | It is employed as a intermediate for pharmaceuticals. |
| | 2-Bromo-4,5-difluoroanisole Preparation Products And Raw materials |
|