| Company Name: |
Merck KGaA |
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Company Name: |
SIGMA-RBI |
| Tel: |
800 736 3690 (Orders) |
| Email: |
|
|
| | 2-Bromoethanol-13C2,1,1,2,2-d4 Basic information |
| Product Name: | 2-Bromoethanol-13C2,1,1,2,2-d4 | | Synonyms: | Ethylene-13C2,d4 bromohydrin;2-Bromoethanol-13C2,1,1,2,2-d4;2-Bromoethanol-13C2,1,1,2,2-d4 | | CAS: | 1216889-96-1 | | MF: | C2HBrD4O | | MW: | 131.01 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | 2-Bromoethanol-13C2,1,1,2,2-d4 Chemical Properties |
| Boiling point | 56-57 °C/20 mmHg(lit.) | | density | 1.846 g/mL at 25 °C(lit.) | | InChI | 1S/C2H5BrO/c3-1-2-4/h4H,1-2H2/i1+1D2,2+1D2 | | InChIKey | LDLCZOVUSADOIV-URIFWVMJSA-N | | SMILES | Br[13C]([2H])([2H])[13C]([2H])([2H])O |
| Hazard Codes | T | | Risk Statements | 23/24/25-34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 2922 8/PG 2 | | WGK Germany | WGK 3 | | Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials | | Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Eye Dam. 1 Skin Corr. 1B |
| | 2-Bromoethanol-13C2,1,1,2,2-d4 Usage And Synthesis |
| | 2-Bromoethanol-13C2,1,1,2,2-d4 Preparation Products And Raw materials |
|