|
|
| | 5-[(4-amino-2-carboxyphenyl)amino]-2-hydroxybenzoic acid Basic information |
| Product Name: | 5-[(4-amino-2-carboxyphenyl)amino]-2-hydroxybenzoic acid | | Synonyms: | 5-[(4-amino-2-carboxyphenyl)amino]-2-hydroxybenzoic acid;5-amino-2-[(3-carboxy-4-hydroxyphenyl)amino]benzoic acid;Mesalazine EP Impurity S;Mesalazine Impurity 11(Mesalazine EP Impurity S);Mesalamine Impurity (2-Hydroxy-5-amino-N-(2-carboxy-4-aminophenyl)benzoic Acid);Mesalazine Impurity 2;Mesalamine Impurity 2;Mesalamine EP Impurity S | | CAS: | 1797983-23-3 | | MF: | C14H12N2O5 | | MW: | 288.26 | | EINECS: | | | Product Categories: | | | Mol File: | 1797983-23-3.mol | ![5-[(4-amino-2-carboxyphenyl)amino]-2-hydroxybenzoic acid Structure](CAS/20180601/GIF/1797983-23-3.gif) |
| | 5-[(4-amino-2-carboxyphenyl)amino]-2-hydroxybenzoic acid Chemical Properties |
| Melting point | >180°C (dec.) | | Boiling point | 542.6±50.0 °C(Predicted) | | density | 1.590±0.06 g/cm3(Predicted) | | storage temp. | Hygroscopic, Refrigerator, Under Inert Atmosphere | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 2.85±0.36(Predicted) | | color | Yellow to Dark Green | | Stability: | Hygroscopic | | InChI | InChI=1S/C14H12N2O5/c15-7-1-3-11(9(5-7)13(18)19)16-8-2-4-12(17)10(6-8)14(20)21/h1-6,16-17H,15H2,(H,18,19)(H,20,21) | | InChIKey | FNKYNYBONZATNB-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC(N)=CC=C1NC1=CC=C(O)C(C(O)=O)=C1 |
| | 5-[(4-amino-2-carboxyphenyl)amino]-2-hydroxybenzoic acid Usage And Synthesis |
| Uses | 2-Hydroxy-5-Amino-N-(2-carboxy-4-aminophenyl)benzoic Acid is an impurity from the synthesis of Mesalamine (M258100). |
| | 5-[(4-amino-2-carboxyphenyl)amino]-2-hydroxybenzoic acid Preparation Products And Raw materials |
|