|
|
| | 1,1-Cyclopropanedicarboxylic acid dimethyl ester Basic information |
| | 1,1-Cyclopropanedicarboxylic acid dimethyl ester Chemical Properties |
| Boiling point | 196-198 °C (lit.) | | density | 1.147 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.441(lit.) | | Fp | 203 °F | | storage temp. | Sealed in dry,Room Temperature | | form | clear liquid | | color | Colorless to Light yellow to Light orange | | InChI | InChI=1S/C7H10O4/c1-10-5(8)7(3-4-7)6(9)11-2/h3-4H2,1-2H3 | | InChIKey | PWLLZZMFFZUSOG-UHFFFAOYSA-N | | SMILES | C(C1(CC1)C(=O)OC)(=O)OC | | CAS DataBase Reference | 6914-71-2(CAS DataBase Reference) | | EPA Substance Registry System | 1,1-Cyclopropanedicarboxylic acid, dimethyl ester (6914-71-2) |
| Risk Statements | 52/53 | | Safety Statements | 61 | | WGK Germany | 1 | | TSCA | TSCA listed | | HS Code | 2902190000 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Aquatic Chronic 3 |
| | 1,1-Cyclopropanedicarboxylic acid dimethyl ester Usage And Synthesis |
| Uses | Dimethyl 1,1-cyclopropanedicarboxylate may be used in the preparation of α-diazo-β-ketoester. | | Synthesis Reference(s) | Synthesis, p. 738, 1987 DOI: 10.1055/s-1987-28069 |
| | 1,1-Cyclopropanedicarboxylic acid dimethyl ester Preparation Products And Raw materials |
|