|
|
| | Fmoc-D-4-Cyanophenylalanine Basic information |
| | Fmoc-D-4-Cyanophenylalanine Chemical Properties |
| Melting point | 188.1 °C | | Boiling point | 531.88°C (rough estimate) | | density | 1.2691 (rough estimate) | | refractive index | 1.5500 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | pka | 3.62±0.10(Predicted) | | form | Solid | | color | White to off-white | | Optical Rotation | Consistent with structure | | Major Application | peptide synthesis | | InChIKey | JOPKKUTWCGYCDA-HSZRJFAPSA-N | | SMILES | OC(=O)[C@@H](Cc1ccc(cc1)C#N)NC(=O)OCC2c3ccccc3-c4ccccc24 | | CAS DataBase Reference | 205526-34-7(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 20/21/22 | | Safety Statements | 36/37 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29223900 | | Storage Class | 11 - Combustible Solids |
| | Fmoc-D-4-Cyanophenylalanine Usage And Synthesis |
| Chemical Properties | off-white to slightly yellow powder | | Uses | peptide synthesis |
| | Fmoc-D-4-Cyanophenylalanine Preparation Products And Raw materials |
|