- 3-Furanboronic acid
-
- $1.00 / 1KG
-
2019-07-06
- CAS:55552-70-0
- Min. Order: 1G
- Purity: 98%
- Supply Ability: 1000KG
|
| | 3-Furanboronic acid Basic information |
| | 3-Furanboronic acid Chemical Properties |
| Melting point | 139-144 °C (dec.) (lit.) | | Boiling point | 247.7±32.0 °C(Predicted) | | density | 1.25±0.1 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | Soluble in methanol. | | form | Crystalline Powder | | pka | 7.95±0.10(Predicted) | | color | Yellow | | BRN | 1635653 | | InChI | InChI=1S/C4H5BO3/c6-5(7)4-1-2-8-3-4/h1-3,6-7H | | InChIKey | CYEFKCRAAGLNHW-UHFFFAOYSA-N | | SMILES | O1C=CC(B(O)O)=C1 | | CAS DataBase Reference | 55552-70-0(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 37/39-26-3-37 | | WGK Germany | 3 | | Hazard Note | Irritant | | HazardClass | IRRITANT, AIR SENSITIVE, KEEP COLD | | HS Code | 29349990 | | Storage Class | 11 - Combustible Solids |
| | 3-Furanboronic acid Usage And Synthesis |
| Chemical Properties | White to light yellow crystal powde | | Uses | Furan-3-boronic acid use furan-3-boronic acid as our coupling partner in many reactions. A chitosan uricase (UOx)-poly (furan-3-boronic acid)(PFBA)-Pd nanoparticles (PdNPs)/plated Pd (Pd plate)/multiwalled carbon nanotubes (MWCNTs)/Au electrode was prepared for fabricating an amperometric biosensor and a biofuel cell (BFC) of uric acid. |
| | 3-Furanboronic acid Preparation Products And Raw materials |
|