HEXADECYL METHACRYLATE manufacturers
- Hexadecyl methacrylate
-
- $0.00 / 200kgkg
-
2026-01-28
- CAS:2495-27-4
- Min. Order: 20kgkg
- Purity: ≥96%
- Supply Ability: 10 tons
- HEXADECYL METHACRYLATE
-
- $1.00 / 1KG
-
2020-02-04
- CAS:2495-27-4
- Min. Order: 1KG
- Purity: 98-99.9%
- Supply Ability: 100kg
|
| | HEXADECYL METHACRYLATE Basic information |
| Product Name: | HEXADECYL METHACRYLATE | | Synonyms: | 2-methyl-2-propenoicacihexadecylester;2-Propenoicacid,2-methyl-,hexadecylester;cetylmethacrylate;Hexadecyl2-methyl-2-propenoate;Methacrylicacid,hexadecylester;1-HEXADECYL METHACRYLATE;HEXADECYL METHACRYLATE;Hexadecyl methacrylate，≥95% | | CAS: | 2495-27-4 | | MF: | C20H38O2 | | MW: | 310.51 | | EINECS: | 219-672-3 | | Product Categories: | monomer | | Mol File: | 2495-27-4.mol |  |
| | HEXADECYL METHACRYLATE Chemical Properties |
| Melting point | 15°C | | Boiling point | 390.66°C (rough estimate) | | density | 0.9849 (rough estimate) | | vapor pressure | 0.06Pa at 20℃ | | refractive index | 1.4498 (estimate) | | storage temp. | Refrigerator | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Oil | | color | Clear Colorless | | Cosmetics Ingredients Functions | NOT REPORTED | | InChI | InChI=1S/C20H38O2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-22-20(21)19(2)3/h2,4-18H2,1,3H3 | | InChIKey | ZNAOFAIBVOMLPV-UHFFFAOYSA-N | | SMILES | C(OCCCCCCCCCCCCCCCC)(=O)C(C)=C | | LogP | 8.64 at 20℃ | | EPA Substance Registry System | Hexadecyl methacrylate (2495-27-4) |
| | HEXADECYL METHACRYLATE Usage And Synthesis |
| Uses | Hexadecyl Methacrylate is a reagent in the synthesis of methacrylate copolymers and terpolymers which are used as lubricating oil pour point depressants. |
| | HEXADECYL METHACRYLATE Preparation Products And Raw materials |
|