3-OXO-3,4-DIHYDRO-2H-1,4-BENZOXAZINE-6-SULFONYL CHLORIDE manufacturers
|
| | 3-OXO-3,4-DIHYDRO-2H-1,4-BENZOXAZINE-6-SULFONYL CHLORIDE Basic information |
| Product Name: | 3-OXO-3,4-DIHYDRO-2H-1,4-BENZOXAZINE-6-SULFONYL CHLORIDE | | Synonyms: | 3,4-Dihydro-3-oxo-2H-1,4-benzoxazine-6-sulphonyl chloride;3-oxo-3,4-dihydro-2H-1,4-benzoxazine-6-sulfonyl chloride(SALTDATA: FREE);6-(Chlorosulphonyl)-3,4-dihydro-3-oxo-2H-1,4-benzoxazine, 3,4-Dihydro-3-oxo-2H-benzo[b][1,4]oxazine-6-sulphonyl chloride;BUTTPARK 76\07-51;3-OXO-3,4-DIHYDRO-2H-1,4-BENZOXAZINE-6-SULFONYL CHLORIDE;3-OXO-3,4-DIHYDRO-2H-BENZO[1,4]OXAZINE-6-SULFONYL CHLORIDE;6-CHLOROSULPHONYL-3-OXO-1,4-BENZOXAZINE;3,4-Dihydro-3-oxo-2H-1,4-benzoxazine-6-sulfonyl chloride | | CAS: | 31794-45-3 | | MF: | C8H6ClNO4S | | MW: | 247.66 | | EINECS: | | | Product Categories: | | | Mol File: | 31794-45-3.mol |  |
| | 3-OXO-3,4-DIHYDRO-2H-1,4-BENZOXAZINE-6-SULFONYL CHLORIDE Chemical Properties |
| Melting point | 178 °C | | Boiling point | 458.0±45.0 °C(Predicted) | | density | 1.582±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | pka | 11.15±0.20(Predicted) | | Appearance | Off-white to light brown Solid | | InChI | InChI=1S/C8H6ClNO4S/c9-15(12,13)5-1-2-7-6(3-5)10-8(11)4-14-7/h1-3H,4H2,(H,10,11) | | InChIKey | CGTCULUUVYBAPX-UHFFFAOYSA-N | | SMILES | O1C2=CC=C(S(Cl)(=O)=O)C=C2NC(=O)C1 |
| | 3-OXO-3,4-DIHYDRO-2H-1,4-BENZOXAZINE-6-SULFONYL CHLORIDE Usage And Synthesis |
| | 3-OXO-3,4-DIHYDRO-2H-1,4-BENZOXAZINE-6-SULFONYL CHLORIDE Preparation Products And Raw materials |
|