|
|
| | RHODAMINE B HYDRAZIDE Basic information |
| Product Name: | RHODAMINE B HYDRAZIDE | | Synonyms: | RHODAMINE B HYDRAZIDE;Spiro[1H-isoindole-1,9'-[9H]xanthen]-3(2H)-one, 2-aMino-3',6'-bis(diethylaMino)-;2-amino-3',6'-bis(diethylamino)spiro[isoindole-3,9'-xanthene]-1-one;2-AMINO-3',6'-BIS(DIETHYLAMINO)SPIRO[ISOINDOLE-1,9'-XANTHENE]-3-ONE;2-Amino-3',6'-bis(diethylamino)spiro[isoindoline-1,9'-xanthen]-3-one;RhodaMine B Cu2+ sensor | | CAS: | 74317-53-6 | | MF: | C28H32N4O2 | | MW: | 456.58 | | EINECS: | | | Product Categories: | | | Mol File: | 74317-53-6.mol |  |
| | RHODAMINE B HYDRAZIDE Chemical Properties |
| Melting point | 176-177 °C | | Boiling point | 643.3±65.0 °C(Predicted) | | density | 1.27±0.1 g/cm3(Predicted) | | solubility | DMF: 30 mg/ml; DMF:PBS(pH7.2) (1:2): 0.33 mg/ml; DMSO: 20 mg/ml; Ethanol: 0.1 mg/ml | | form | A crystalline solid | | pka | 6.44±0.20(Predicted) | | color | Off-white to yellow | | InChI | InChI=1S/C28H32N4O2/c1-5-30(6-2)19-13-15-23-25(17-19)34-26-18-20(31(7-3)8-4)14-16-24(26)28(23)22-12-10-9-11-21(22)27(33)32(28)29/h9-18H,5-8,29H2,1-4H3 | | InChIKey | WTDHTIVYKKLOTC-UHFFFAOYSA-N | | SMILES | C12(C3=C(C=C(N(CC)CC)C=C3)OC3=C1C=CC(N(CC)CC)=C3)C1=C(C=CC=C1)C(=O)N2N |
| Hazard Codes | Xn | | Risk Statements | 22-37/38-41 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 32049010 |
| | RHODAMINE B HYDRAZIDE Usage And Synthesis |
| Uses | Rhodamine B hydrazide is a good probe for sulfite, with colorless and non-fluorescent properties. While the emission is related to the concentration of sulfite (5-800 ng/mL; detection limit=1.4 ng/mL (3σ)). Sulfite reduces dissolved oxygen to yield superoxide radicals, which binds to Rhodamine B hydrazide to form Rhodamine B. Rhodamine B hydrazide gives Rhodamine B-like fluorescence in the presence of sulfite, which is enhanced by Tween 80 surfactant micelles. Rhodamine B hydrazide has an absorption maximum at 554 nm and a fluorescence emission maximum at 574 nm[1]. | | References | [1] Yang X F, et al. Novel spectrofluorimetric method for the determination of sulfite with rhodamine B hydrazide in a micellar medium[J]. Analytica Chimica Acta, 2002, 456(1): 121-128. |
| | RHODAMINE B HYDRAZIDE Preparation Products And Raw materials |
|