|
|
| | AKOS B000681 Basic information |
| Product Name: | AKOS B000681 | | Synonyms: | AKOS B000681;ART-CHEM-BB B000681;Isopropyl 2-amino-4,5-dimethylthiophene-3-carboxylate;Isopropyl 2-amino-4,5-dimethyl-3-thiophenecarboxylate;2-amino-4,5-dimethyl-3-thiophenecarboxylic acid isopropyl ester;2-amino-4,5-dimethyl-thiophene-3-carboxylic acid isopropyl ester;propan-2-yl 2-amino-4,5-dimethyl-thiophene-3-carboxylate;propan-2-yl 2-amino-4,5-dimethylthiophene-3-carboxylate | | CAS: | 350988-44-2 | | MF: | C10H15NO2S | | MW: | 213.3 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | AKOS B000681 Chemical Properties |
| Boiling point | 311.5±37.0 °C(Predicted) | | density | 1.152±0.06 g/cm3(Predicted) | | pka | 0.54±0.10(Predicted) | | form | solid | | InChI | 1S/C10H15NO2S/c1-5(2)13-10(12)8-6(3)7(4)14-9(8)11/h5H,11H2,1-4H3 | | InChIKey | PXWXBFMFSLKMJA-UHFFFAOYSA-N | | SMILES | CC(C)OC(=O)c1c(N)sc(C)c1C |
| Hazard Codes | Xi | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids |
| | AKOS B000681 Usage And Synthesis |
| | AKOS B000681 Preparation Products And Raw materials |
|