| Company Name: |
Shanghai Hanhong Scientific Co.,Ltd.
|
| Tel: |
021-54306202 13764082696 |
| Email: |
info@hanhongsci.com |
| Products Intro: |
Product Name:7-Nitro-3,4-benzocoumarin
CAS:6638-64-8
Purity:98% Remarks:B83056
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:7-Nitro-3,4-benzocoumarin
CAS:6638-64-8
Purity:98% Package:1G Remarks:130184-1G
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
| Products Intro: |
Product Name:7-Nitro-3,4-benzocoumarin 98%
CAS:6638-64-8
Purity:98% Package:1g Remarks:NULL
|
|
| | 7-NITRO-3,4-BENZOCOUMARIN Basic information |
| | 7-NITRO-3,4-BENZOCOUMARIN Chemical Properties |
| Melting point | 203-205 °C (lit.) | | Boiling point | 431.5±24.0 °C(Predicted) | | density | 1.457±0.06 g/cm3(Predicted) | | form | solid | | InChI | 1S/C13H7NO4/c15-13-11-4-2-1-3-9(11)10-6-5-8(14(16)17)7-12(10)18-13/h1-7H | | InChIKey | KWGYGQPIDANWAX-UHFFFAOYSA-N | | SMILES | [O-][N+](=O)c1ccc-2c(OC(=O)c3ccccc-23)c1 |
| Hazard Codes | Xn | | Risk Statements | 22-36 | | Safety Statements | 26 | | RIDADR | UN 2811 6.1/PG 3 | | WGK Germany | 2 | | RTECS | HP8757700 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral
Eye Irrit. 2 |
| | 7-NITRO-3,4-BENZOCOUMARIN Usage And Synthesis |
| Uses | 7-Nitro-3,4-benzocoumarin was prepared by the oxidation of 4′-nitrobiphenyl-2-carboxylic acid. | | General Description | 7-Nitro-3,4-benzocoumarin was prepared by the oxidation of 4′-nitrobiphenyl-2-carboxylic acid. |
| | 7-NITRO-3,4-BENZOCOUMARIN Preparation Products And Raw materials |
|