|
|
| | DL-Lysine acetylsalicylate Basic information |
| | DL-Lysine acetylsalicylate Chemical Properties |
| Melting point | 154-156°C | | Boiling point | 464.39°C (rough estimate) | | density | 1.1829 (rough estimate) | | refractive index | 1.6280 (estimate) | | storage temp. | -20°C Freezer | | solubility | Methanol (Slightly), Water (Slightly) | | form | Solid | | color | White | | InChI | InChI=1S/C9H8O4.C6H14N2O2/c1-6(10)13-8-5-3-2-4-7(8)9(11)12;7-4-2-1-3-5(8)6(9)10/h2-5H,1H3,(H,11,12);5H,1-4,7-8H2,(H,9,10) | | InChIKey | JJBCTCGUOQYZHK-UHFFFAOYSA-N | | SMILES | C(N)(C(=O)O)CCCCN.C(C1C=CC=CC=1OC(=O)C)(=O)O | | CAS DataBase Reference | 62952-06-1(CAS DataBase Reference) | | EPA Substance Registry System | Aspirin DL-lysine (62952-06-1) |
| WGK Germany | WGK 3 | | TSCA | TSCA listed | | Storage Class | 11 - Combustible Solids | | Toxicity | LD50 orl-rat: 4350 mg/kg IYKEDH 13,1128,82 |
| | DL-Lysine acetylsalicylate Usage And Synthesis |
| Chemical Properties | Crystalline Solid | | Uses | Non-steroidal anti-inflammatory drugs (NSAIDs) may inhibit cancer growth. Water soluble, injectable aspirin derivative.Analgesic; antipyretic; anti-inflammatory. | | Safety Profile | Moderately toxic by ingestion andother routes. When heated to decomposition it emits toxicfumes of NOx. |
| | DL-Lysine acetylsalicylate Preparation Products And Raw materials |
|