|
|
| | 7H-Dodecafluoroheptanoic acid Basic information |
| Product Name: | 7H-Dodecafluoroheptanoic acid | | Synonyms: | 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoro-heptanoicaci;7-h-dodekafluorheptansaeure;dodecafluoroheptanoicacid;omega-h-dodekafluorheptansaeure;omega-monohydroperfluoroheptanoicacid;2,2,3,3,4,4,5,5,6,6,7,7-DODECAFLUOROHEPTANOIC ACID;DAIKIN C-5600;7H-DODECAFLUOROHEPTANOIC ACID | | CAS: | 1546-95-8 | | MF: | C7H2F12O2 | | MW: | 346.07 | | EINECS: | 216-283-0 | | Product Categories: | | | Mol File: | 1546-95-8.mol |  |
| | 7H-Dodecafluoroheptanoic acid Chemical Properties |
| Melting point | 32-36 °C(lit.) | | Boiling point | 192 °C(lit.) | | density | 1.792 | | Fp | >230 °F | | solubility | Chloroform (Sparingly), Ethyl Acetate (Slightly), Methanol (Slightly) | | pka | 0.53±0.10(Predicted) | | form | low melting solid | | color | Colourless/white | | InChI | InChI=1S/C7H2F12O2/c8-1(9)3(10,11)5(14,15)7(18,19)6(16,17)4(12,13)2(20)21/h1H,(H,20,21) | | InChIKey | JZHDEEOTEUVLHR-UHFFFAOYSA-N | | SMILES | C(O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F | | CAS DataBase Reference | 1546-95-8(CAS DataBase Reference) | | EPA Substance Registry System | 7H-Perfluoroheptanoic acid (1546-95-8) |
| Hazard Codes | C | | Risk Statements | 22-34 | | Safety Statements | 26-27-36/37/39-45 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | RTECS | MJ2030000 | | HazardClass | CORROSIVE | | HS Code | 2915907098 |
| | 7H-Dodecafluoroheptanoic acid Usage And Synthesis |
| Uses | 7H-Dodecafluoroheptanoic Acid is a derivative of Heptanoic Acid (H998455) which can be used as an organic building blocks for the synthesis of variety of chemical compounds. Heptanoic Acid is used in the synthesis of 17-epi-Testosterone Enanthate (T155095). It is used in the preparation of esters, such as ethyl heptanoate, which are used in fragrances and as artificial flavors. It is also one of many additives in cigarettes. |
| | 7H-Dodecafluoroheptanoic acid Preparation Products And Raw materials |
| Preparation Products | 1H,6H-PERFLUOROHEXANE-->2,2,3,3,4,4,5,5,6,6,7,7-DODECAFLUOROHEPTANOIC ACID, SODIUM SALT |
|