METHYL 2-(2-AMINO-5-METHYL-1,3-THIAZOL-4-YL)ACETATE manufacturers
|
| | METHYL 2-(2-AMINO-5-METHYL-1,3-THIAZOL-4-YL)ACETATE Basic information |
| Product Name: | METHYL 2-(2-AMINO-5-METHYL-1,3-THIAZOL-4-YL)ACETATE | | Synonyms: | METHYL (2-AMINO-5-METHYL-1,3-THIAZOL-4-YL)ACETATE;METHYL 2-(2-AMINO-5-METHYL-1,3-THIAZOL-4-YL)ACETATE;5-CHLORO-1,2,3,4-TETRAHYDRO-[2,6]NAPHTHYRIDINE;methyl 2-(2-amino-5-methylthiazol-4-yl)acetate;METHYL 2-(2-AMINO-5-METHYL-1,3-THIAZOL-4-YL)ACETATE###72054-60-5;2-amino-5-ethoxycarbonyl-4-methylthiazole;4-Thiazolecarboxylic acid, 2-amino-5-methyl-, ethyl ester | | CAS: | 72054-60-5 | | MF: | C7H10N2O2S | | MW: | 186.23 | | EINECS: | | | Product Categories: | | | Mol File: | 72054-60-5.mol |  |
| | METHYL 2-(2-AMINO-5-METHYL-1,3-THIAZOL-4-YL)ACETATE Chemical Properties |
| Melting point | 111-113°C | | Boiling point | 313.1±22.0 °C(Predicted) | | density | 1.283±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C(protect from light) | | pka | 3.08±0.10(Predicted) | | Appearance | Light yellow to yellow Solid | | InChI | InChI=1S/C7H10N2O2S/c1-3-11-6(10)5-4(2)12-7(8)9-5/h3H2,1-2H3,(H2,8,9) | | InChIKey | KTGUPAFUVGHOQS-UHFFFAOYSA-N | | SMILES | S1C(C)=C(C(OCC)=O)N=C1N |
| | METHYL 2-(2-AMINO-5-METHYL-1,3-THIAZOL-4-YL)ACETATE Usage And Synthesis |
| Synthesis | Step 2: Synthesis of ethyl 2-amino-5-methylthiazole-4-carboxylate
Thiourea (47 g, 616.83 mmol) was added to a solution of ethyl 2-chloro-3-oxobutanoate (100 g, 577.19 mmol) in ethanol (1000 mL). The resulting mixture was stirred and reacted under reflux conditions for 2 hours. Upon completion of the reaction, the reaction mixture was cooled to room temperature in a water/ice bath. The precipitate was collected by filtration to give 105 g (93% yield) of ethyl 2-amino-5-methylthiazole-4-carboxylate as a light yellow solid. | | References | [1] Patent: US2008/139558, 2008, A1. Location in patent: Page/Page column 51 |
| | METHYL 2-(2-AMINO-5-METHYL-1,3-THIAZOL-4-YL)ACETATE Preparation Products And Raw materials |
|