|
|
| | Aluminium tri-sec-butoxide Basic information |
| | Aluminium tri-sec-butoxide Chemical Properties |
| Boiling point | 40 °C | | density | 0.967 g/mL at 25 °C(lit.) | | vapor pressure | 23 hPa (195 °C) | | refractive index | 1.4390 | | Fp | 82 °F | | storage temp. | Store below +30°C. | | solubility | Miscible with alcohol, isopropyl alcohol and toluene. | | form | Oily Liquid | | color | Light yellow | | Specific Gravity | 0.9671 | | explosive limit | 1.7-9.8%(V) | | Water Solubility | decomposes | | Sensitive | Moisture Sensitive | | Hydrolytic Sensitivity | 8: reacts rapidly with moisture, water, protic solvents | | BRN | 3910908 | | Stability: | Stability Stable, but may decompose upon exposure to air and moisture. Flammable. Incompatible with strong oxidizing agents, strong acids, water. | | Cosmetics Ingredients Functions | LIGHT STABILIZER | | InChI | 1S/3C4H9O.Al/c3*1-3-4(2)5;/h3*4H,3H2,1-2H3;/q3*-1;+3 | | InChIKey | WOZZOSDBXABUFO-UHFFFAOYSA-N | | SMILES | CCC(C)O[Al](OC(C)CC)OC(C)CC | | CAS DataBase Reference | 2269-22-9(CAS DataBase Reference) | | NIST Chemistry Reference | Aluminum tri-sec-butoxide(2269-22-9) | | EPA Substance Registry System | 2-Butanol, aluminum salt (2269-22-9) |
| Hazard Codes | Xn,Xi | | Risk Statements | 40-21/22-10 | | Safety Statements | 36/37-45-43-36/37/39-26-16 | | RIDADR | UN 1992 3/PG 3 | | WGK Germany | 3 | | F | 3-10-23 | | Autoignition Temperature | 763 °F | | TSCA | TSCA listed | | HazardClass | 3 | | PackingGroup | III | | HS Code | 29051900 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 4 Oral Flam. Liq. 3 | | Toxicity | LD50 orally in Rabbit: 401 mg/kg LD50 dermal Rabbit 402 mg/kg |
| | Aluminium tri-sec-butoxide Usage And Synthesis |
| Chemical Properties | viscous colourless or pale yellow liquid | | Uses | It is used for active catalyst and support, inorganic membrane, redrcing agent of aldehyde-ketone, oxidant of aldehyde-ketone, gel forming agent of printing ink and paint, dehydrant, water proofing agent and aluminum base grease. | | Flammability and Explosibility | Flammable | | reaction suitability | core: aluminum |
| | Aluminium tri-sec-butoxide Preparation Products And Raw materials |
|