- Trihexylphosphine
-
-
2026-07-30
- CAS:4168-73-4
- Min. Order: 1KG
- Purity: 98%min
- Supply Ability: 30tons/month
- TRIHEXYLPHOSPHINE
-
- $10.00
-
2026-03-20
- CAS:4168-73-4
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 5tons
- Trihexylphosphine
-
- $1.00
-
2025-12-12
- CAS:4168-73-4
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 20 tons
|
| | TRIHEXYLPHOSPHINE Basic information |
| | TRIHEXYLPHOSPHINE Chemical Properties |
| Melting point | 20℃ | | Boiling point | 227 °C / 50mmHg | | density | 0,83 g/cm3 | | refractive index | 1.4640 to 1.4680 | | storage temp. | 2-8°C, protect from light, stored under nitrogen | | form | liquid | | color | colorless | | Sensitive | air sensitive | | InChI | InChI=1S/C18H39P/c1-4-7-10-13-16-19(17-14-11-8-5-2)18-15-12-9-6-3/h4-18H2,1-3H3 | | InChIKey | FPZZZGJWXOHLDJ-UHFFFAOYSA-N | | SMILES | P(CCCCCC)(CCCCCC)CCCCCC |
| | TRIHEXYLPHOSPHINE Usage And Synthesis |
| Uses | Trihexylphosphine is used as an intermediate in organic syntheses. |
| | TRIHEXYLPHOSPHINE Preparation Products And Raw materials |
|