- 3-Bromobenzylamine
-
- $1.00 / 1KG
-
2019-12-31
- CAS:10269-01-9
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 100KG
|
| | 3-Bromobenzylamine Basic information |
| | 3-Bromobenzylamine Chemical Properties |
| Boiling point | 245°C(lit.) | | density | 1.48g/ml | | refractive index | 1.584-1.586 | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | form | Liquid | | pka | 8.77±0.10(Predicted) | | color | Clear colorless to yellow | | Water Solubility | Slightly soluble in water. | | Sensitive | Air Sensitive | | InChI | InChI=1S/C7H8BrN/c8-7-3-1-2-6(4-7)5-9/h1-4H,5,9H2 | | InChIKey | SUYJXERPRICYRX-UHFFFAOYSA-N | | SMILES | C1(CN)=CC=CC(Br)=C1 | | CAS DataBase Reference | 10269-01-9(CAS DataBase Reference) |
| Hazard Codes | C | | Risk Statements | 34-21/22 | | Safety Statements | 45-36/37/39-26 | | RIDADR | UN2735 | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29214900 |
| | 3-Bromobenzylamine Usage And Synthesis |
| Chemical Properties | clear yellow liquid | | Uses | 3-Bromobenzylamine is an important raw material and intermediate used in organic synthesis, pharmaceuticals, agro chemicals, dyestuff. |
| | 3-Bromobenzylamine Preparation Products And Raw materials |
|