| Company Name: |
JMR BIO SCIENCES
|
| Tel: |
+91 9036832872 |
| Email: |
jmrbiosciences@gmail.com |
| Products Intro: |
Product Name:3,5-Dibromo-1-methyl-1H-pyrazole CAS:1361019-05-7 Purity:99% Package:1 kg,5 kg, 10 kg,25kg and 1 MT
|
|
| | 1H-Pyrazole, 3,5-dibromo-1-methyl- Basic information |
| | 1H-Pyrazole, 3,5-dibromo-1-methyl- Chemical Properties |
| Boiling point | 258.8±20.0 °C(Predicted) | | density | 2.22±0.1 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | pka | -1.51±0.10(Predicted) | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C4H4Br2N2/c1-8-4(6)2-3(5)7-8/h2H,1H3 | | InChIKey | KFOQLTKNWNGAHL-UHFFFAOYSA-N | | SMILES | N1(C)C(Br)=CC(Br)=N1 |
| | 1H-Pyrazole, 3,5-dibromo-1-methyl- Usage And Synthesis |
| | 1H-Pyrazole, 3,5-dibromo-1-methyl- Preparation Products And Raw materials |
|