|
|
| | Tetrapentylammonium iodide Basic information |
| | Tetrapentylammonium iodide Chemical Properties |
| Melting point | 134-137 °C | | storage temp. | Store below +30°C. | | solubility | 7.40g/l | | form | powder to crystal | | color | White to Almost white | | Water Solubility | 7.40g/L | | Sensitive | Light Sensitive | | BRN | 3917412 | | InChI | 1S/C20H44N.HI/c1-5-9-13-17-21(18-14-10-6-2,19-15-11-7-3)20-16-12-8-4;/h5-20H2,1-4H3;1H/q+1;/p-1 | | InChIKey | FBLZDUAOBOMSNZ-UHFFFAOYSA-M | | SMILES | [I-].[N+](CCCCC)(CCCCC)(CCCCC)CCCCC | | CAS DataBase Reference | 2498-20-6(CAS DataBase Reference) | | EPA Substance Registry System | Tetrapentylammonium iodide (2498-20-6) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | RIDADR | 2811 | | WGK Germany | 3 | | F | 8 | | TSCA | TSCA listed | | HS Code | 2923.90.0100 | | PackingGroup | III | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | Tetrapentylammonium iodide Usage And Synthesis |
| Chemical Properties | Liquid | | Uses | Tetraamylammonium Iodide is is a quaternary ammonium based antimicrobial used as a bacteriostat, deodorant, disinfectant and(or) a microbiocide. | | Purification Methods | Crystallise the iodide from EtOH and dry it at 35o under a vacuum. It has also been purified by dissolving in acetone and precipitating by adding diethyl ether, and drying at 50o for 2 days. [Beilstein 4 IV 677.] |
| | Tetrapentylammonium iodide Preparation Products And Raw materials |
|