|
|
| | 6-AMINO-1,3-DIPROPYLURACIL Basic information |
| Product Name: | 6-AMINO-1,3-DIPROPYLURACIL | | Synonyms: | AKOS BBS-00006550;6-AMINO-1,3-DIPROPYL-1H-PYRIMIDINE-2,4-DIONE;6-AMINO-1,3-DIPROPYL-2,4(1H,3H)-PYRIMIDINEDIONE;6-AMINO-1,3-DIPROPYLURACIL;SALOR-INT L157864-1EA;SPECS AB-323/25048034;1,3-DIPROPYL-6-AMINOURACIL;6-amino-1,3-dipropylpyrimidine-2,4-dione | | CAS: | 41862-14-0 | | MF: | C10H17N3O2 | | MW: | 211.26 | | EINECS: | | | Product Categories: | Nucleotides and Nucleosides;Bases & Related Reagents;Intermediates;Nucleotides;Building Blocks;C9 to C11;Chemical Synthesis;Heterocyclic Building Blocks;Pyrimidines | | Mol File: | 41862-14-0.mol |  |
| | 6-AMINO-1,3-DIPROPYLURACIL Chemical Properties |
| Melting point | 134-139 °C | | Boiling point | 308.3±45.0 °C(Predicted) | | density | 1.120±0.06 g/cm3(Predicted) | | storage temp. | -20°C Freezer | | solubility | Dichloromethane, Ethyl Acetate, Methanol | | form | Solid | | pka | 5.17±0.70(Predicted) | | color | White | | InChI | 1S/C10H17N3O2/c1-3-5-12-8(11)7-9(14)13(6-4-2)10(12)15/h7H,3-6,11H2,1-2H3 | | InChIKey | WWYIZMBRAYKRFU-UHFFFAOYSA-N | | SMILES | CCCN1C(N)=CC(=O)N(CCC)C1=O | | CAS DataBase Reference | 41862-14-0(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 6-AMINO-1,3-DIPROPYLURACIL Usage And Synthesis |
| Chemical Properties | White Crystalline Solid | | Uses | As an intermediate, 6-AMino-1,3-dipropyluracil can been used for the sythesis of xanthine derivatives | | Uses | 6-Amino-1,3-dipropyluracil can be used in the synthesis of compounds of medicinal interest such as deazaflavins, pyrido[2,3-d]pyrimidines and tetrahydrobenzo[g]pyrimido[4,5-c]isoquinoline tetraones. |
| | 6-AMINO-1,3-DIPROPYLURACIL Preparation Products And Raw materials |
|