|
|
| | 4-CHLORO-3(2H)-PYRIDAZINONE Basic information |
| Product Name: | 4-CHLORO-3(2H)-PYRIDAZINONE | | Synonyms: | 4-CHLORO-3(2H)-PYRIDAZINONE;5-chloro-1H-pyridazin-6-one;4-CHLOROPYRIDAZIN-3-OL;3(2H)-Pyridazinone,4-chloro-(;4-Chloropyridazin-3(2H)-one;4-Chloro-3-pyridazone;4-chloro-2,3-dihydropyridazin-3-one;4-Chloro-2H-pyridazin-3-one | | CAS: | 1677-79-8 | | MF: | C4H3ClN2O | | MW: | 130.53 | | EINECS: | 200-001-2 | | Product Categories: | | | Mol File: | 1677-79-8.mol |  |
| | 4-CHLORO-3(2H)-PYRIDAZINONE Chemical Properties |
| density | 1.55±0.1 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 9.80±0.40(Predicted) | | Appearance | White to yellow Solid | | InChI | InChI=1S/C4H3ClN2O/c5-3-1-2-6-7-4(3)8/h1-2H,(H,7,8) | | InChIKey | UYWAYTBDMJFIQT-UHFFFAOYSA-N | | SMILES | C1(=O)NN=CC=C1Cl |
| | 4-CHLORO-3(2H)-PYRIDAZINONE Usage And Synthesis |
| | 4-CHLORO-3(2H)-PYRIDAZINONE Preparation Products And Raw materials |
|