- N-Cbz-L-Phenylalanine
-
- $0.00 / 1KG
-
2026-04-03
- CAS:1161-13-3
- Min. Order: 10g
- Purity: 99%min
- Supply Ability: 100kgs
- N-Cbz-L-Phenylalanine
-
- $1.00 / 1KG
-
2019-07-06
- CAS:1161-13-3
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 20kg
|
| | N-Cbz-L-Phenylalanine Basic information |
| | N-Cbz-L-Phenylalanine Chemical Properties |
| Melting point | 85-87 °C(lit.) | | alpha | 5 º (c=5,acetic acid) | | Boiling point | 440.65°C (rough estimate) | | density | 1.1441 (rough estimate) | | refractive index | 5.3 ° (C=4, AcOH) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | DMF (Sparingly), DMSO (Slightly), Methanol (Slightly) | | pka | 3.86±0.10(Predicted) | | form | Powder | | color | White to off-white | | Optical Rotation | [α]20/D +5°, c = 5 in acetic acid | | BRN | 2222826 | | Major Application | peptide synthesis | | InChI | 1S/C17H17NO4/c19-16(20)15(11-13-7-3-1-4-8-13)18-17(21)22-12-14-9-5-2-6-10-14/h1-10,15H,11-12H2,(H,18,21)(H,19,20)/t15-/m0/s1 | | InChIKey | RRONHWAVOYADJL-HNNXBMFYSA-N | | SMILES | OC(=O)[C@H](Cc1ccccc1)NC(=O)OCc2ccccc2 | | CAS DataBase Reference | 1161-13-3(CAS DataBase Reference) |
| | N-Cbz-L-Phenylalanine Usage And Synthesis |
| Chemical Properties | white amorphous powder | | Uses | N-Cbz-L-Phenylalanine is used in the synthesis of neurokinin antagonists. Furthermore it is used in the preparation of Co(II), Zn(II), and Cd(II) complexes with N-benzyloxycarbonyl-S-phen ylalanine that displays antimicrobial activity against common strains of bacteria. | | Uses | Inhibitor of thermolysin | | Uses | N-(Carbobenzyloxy)-L-phenylalanine is used in the synthesis of neurokinin antagonists. Furthermore it is used in the preparation of Co(II), Zn(II), and Cd(II) complexes with N-benzyloxycarbonyl-S-phenylalanine that displays antimicrobial activity against common strains of bacteria. | | reaction suitability | reaction type: solution phase peptide synthesis | | Biochem/physiol Actions | Inhibitor of thermolysin |
| | N-Cbz-L-Phenylalanine Preparation Products And Raw materials |
|