|
|
| | 3-Methyl-1-phenyl-2-phospholene 1-oxide Basic information |
| | 3-Methyl-1-phenyl-2-phospholene 1-oxide Chemical Properties |
| Melting point | 58-62 °C | | Boiling point | 150 °C/0.15 mmHg (lit.) | | density | 1.11±0.1 g/cm3(Predicted) | | refractive index | n20/D 1.5707(lit.) | | Fp | >230 °F | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | Soluble in polar solvents. | | form | Lumps | | color | White to cream | | Sensitive | Hygroscopic | | BRN | 609223 | | InChI | InChI=1S/C11H13OP/c1-10-7-8-13(12,9-10)11-5-3-2-4-6-11/h2-6,9H,7-8H2,1H3 | | InChIKey | YMKWWHFRGALXLE-UHFFFAOYSA-N | | SMILES | P1(=O)(C2=CC=CC=C2)C=C(C)CC1 | | CAS DataBase Reference | 707-61-9(CAS DataBase Reference) | | EPA Substance Registry System | 1H-Phosphole, 2,3-dihydro-4-methyl-1-phenyl-, 1-oxide (707-61-9) |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-36/37/38-40 | | Safety Statements | 26-28-36/37/39-45 | | WGK Germany | 3 | | RTECS | SZ6105100 | | TSCA | TSCA listed | | HS Code | 2931499090 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 3 Carc. 2 |
| | 3-Methyl-1-phenyl-2-phospholene 1-oxide Usage And Synthesis |
| Chemical Properties | white to yellow adhering crystals | | Uses | 3-Methyl-1-phenyl-2-phospholene 1-oxide is used as a catalyst for intramolecular aza-wittig cyclization reactions and polymerization reactions. It is a reactant used for the preparation of phospha sugars and their radical bromination derivatives as anticancer agents. | | Application | Catalyst for: Intramolecular aza-Wittig cyclization reactions Polymerization reactions Reactant for preparation of: Phospha sugars and their radical bromination derivatives as anticancer agents | | reaction suitability | reaction type: Buchwald-Hartwig Cross Coupling Reaction reaction type: Heck Reaction reaction type: Hiyama Coupling reaction type: Negishi Coupling reaction type: Sonogashira Coupling reaction type: Stille Coupling reaction type: Suzuki-Miyaura Coupling |
| | 3-Methyl-1-phenyl-2-phospholene 1-oxide Preparation Products And Raw materials |
|