- TSTU
-
-
2026-08-21
- CAS:105832-38-0
- Min. Order: 1kg
- Purity: 99.9%
- Supply Ability: 20T
- TSTU
-
-
2025-06-20
- CAS:105832-38-0
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 100MT/Month
|
| Product Name: | TSTU | | Synonyms: | HONSTU;O-(N-SUCCINIMIDYL)-1,1,3,3-TETRAMETHYLURONIUM TETRAFLUOROBORATE;O-(N-SucciniMidyl)-1,1,3,3-tetraMethyl uraniuM tetrafluoroborate;TSTU, N-{(Dimethylamino)[(2,5-dioxopyrrolidin-1-yl)oxy]methylidene}-N-methylmethylaminium tetrafluoroborate;2-Succinimido-1,1,3,3-tetra-methyluronium etrafluoroborate
O-(N-Succinimidyl)-N,N,N',N'-tetramethyluronium tetrafluoroborate;N,N,N′,N′-Tetramethyl-O-(N-succinimidyl)uronium tetrafluoroborate,O-(N-Succinimidyl)-N,N,N′,N′-tetramethyluronium tetrafluoroborate, TSTU;2-Succinimido-1,1,3;N,N,N′,N′-Tetramethyl-O-(N-succinimidyl)uroniu | | CAS: | 105832-38-0 | | MF: | C9H16BF4N3O3 | | MW: | 301.05 | | EINECS: | 629-651-4 | | Product Categories: | Biochemistry;Condensation & Active Esterification;Coupling Reactions (Peptide Synthesis);N-Substituted Maleimides, Succinimides & Phthalimides;N-Substituted Succinimides;Peptide Synthesis;Synthetic Organic Chemistry;Peptide;Coupling Reagent;Peptide Coupling Reagents | | Mol File: | 105832-38-0.mol |  |
| Melting point | 198-201 °C(lit.) | | density | 1.41 g/cm | | storage temp. | 2-8°C | | solubility | acetonitrile: 0.1 g/mL, clear | | form | Crystalline Powder or Needles | | color | White to off-white | | Sensitive | Moisture Sensitive | | Major Application | peptide synthesis | | InChI | InChI=1S/C9H16N3O3.BF4/c1-10(2)9(11(3)4)15-12-7(13)5-6-8(12)14;2-1(3,4)5/h5-6H2,1-4H3;/q+1;-1 | | InChIKey | BVYYWTQJMFGHLU-UHFFFAOYSA-M | | SMILES | [B+3]([F-])([F-])([F-])[F-].O(N1C(CCC1=O)=O)/C(=[N+](\C)/C)/N(C)C | | CAS DataBase Reference | 105832-38-0(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-37/39 | | RIDADR | 1759 | | WGK Germany | 3 | | F | 8-10-21 | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29280000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Skin Sens. 1A |
| Chemical Properties | White crystalline | | Uses | peptide coupling reagent converts carboxylates to N-succinimidyl active esters | | Uses | Reagent for the clean in-situ formation of N-succinimidyl active esters | | Uses | TSTU is used as a peptide coupling reagent in solvent systems. | | General Description | N,N,N′,N′-Tetramethyl-O-(N-succinimidyl)uronium tetrafluoroborate is commonly used for the conversion of carboxylic acid into the corresponding N-hydroxysuccinimidyl (NHS) ester. | | reaction suitability | reaction type: Coupling Reactions |
| | TSTU Preparation Products And Raw materials |
| Preparation Products | N-Succinimidyl 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecanoate-->hexadecanedioic acid tert-butyl ester N-hydroxysuccinimide ester |
|